EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C11H12NO3 |
| Net Charge | -1 |
| Average Mass | 206.221 |
| Monoisotopic Mass | 206.08227 |
| SMILES | CC(=O)N[C@H](Cc1ccccc1)C(=O)[O-] |
| InChI | InChI=1S/C11H13NO3/c1-8(13)12-10(11(14)15)7-9-5-3-2-4-6-9/h2-6,10H,7H2,1H3,(H,12,13)(H,14,15)/p-1/t10-/m1/s1 |
| InChIKey | CBQJSKKFNMDLON-SNVBAGLBSA-M |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| N-acetyl-D-phenylalaninate (CHEBI:143878) is a N-acyl-D-α-amino acid anion (CHEBI:59876) |
| N-acetyl-D-phenylalaninate (CHEBI:143878) is conjugate base of N-acetyl-D-phenylalanine (CHEBI:28203) |
| N-acetyl-D-phenylalaninate (CHEBI:143878) is enantiomer of N-acetyl-L-phenylalaninate (CHEBI:57702) |
| Incoming Relation(s) |
| N-acetyl-D-phenylalanine (CHEBI:28203) is conjugate acid of N-acetyl-D-phenylalaninate (CHEBI:143878) |
| N-acetyl-L-phenylalaninate (CHEBI:57702) is enantiomer of N-acetyl-D-phenylalaninate (CHEBI:143878) |
| IUPAC Name |
|---|
| (2R)-2-acetamido-3-phenylpropanoate |
| UniProt Name | Source |
|---|---|
| N-acetyl-D-phenylalanine | UniProt |
| Citations |
|---|