EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C10H10NO3R |
| Net Charge | 0 |
| Average Mass (excl. R groups) | 192.191 |
| Monoisotopic Mass (excl. R groups) | 192.06607 |
| SMILES | *C(=O)N[C@H](Cc1ccccc1)C(=O)O |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| N-acyl-D-phenylalanine (CHEBI:77672) has functional parent D-phenylalanine (CHEBI:16998) |
| N-acyl-D-phenylalanine (CHEBI:77672) is a N-acyl-D-amino acid (CHEBI:15778) |
| N-acyl-D-phenylalanine (CHEBI:77672) is enantiomer of N-acyl-L-phenylalanine (CHEBI:77673) |
| Incoming Relation(s) |
| N-acetyl-D-phenylalanine (CHEBI:28203) is a N-acyl-D-phenylalanine (CHEBI:77672) |
| nateglinide (CHEBI:31897) is a N-acyl-D-phenylalanine (CHEBI:77672) |
| N-acyl-L-phenylalanine (CHEBI:77673) is enantiomer of N-acyl-D-phenylalanine (CHEBI:77672) |