EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C12H16O7 |
| Net Charge | 0 |
| Average Mass | 272.253 |
| Monoisotopic Mass | 272.08960 |
| SMILES | OC[C@H]1O[C@@H](Oc2ccc(O)cc2)[C@H](O)[C@@H](O)[C@@H]1O |
| InChI | InChI=1S/C12H16O7/c13-5-8-9(15)10(16)11(17)12(19-8)18-7-3-1-6(14)2-4-7/h1-4,8-17H,5H2/t8-,9-,10+,11-,12-/m1/s1 |
| InChIKey | BJRNKVDFDLYUGJ-RMPHRYRLSA-N |
| Wikipedia |
|---|
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Escherichia coli (ncbitaxon:562) | - | PubMed (21988831) |
| Roles Classification |
|---|
| Biological Roles: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. Escherichia coli metabolite Any bacterial metabolite produced during a metabolic reaction in Escherichia coli. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| hydroquinone O-β-D-glucopyranoside (CHEBI:18305) has functional parent hydroquinone (CHEBI:17594) |
| hydroquinone O-β-D-glucopyranoside (CHEBI:18305) has role Escherichia coli metabolite (CHEBI:76971) |
| hydroquinone O-β-D-glucopyranoside (CHEBI:18305) has role plant metabolite (CHEBI:76924) |
| hydroquinone O-β-D-glucopyranoside (CHEBI:18305) is a monosaccharide derivative (CHEBI:63367) |
| hydroquinone O-β-D-glucopyranoside (CHEBI:18305) is a β-D-glucoside (CHEBI:22798) |
| Incoming Relation(s) |
| arbutin 6-phosphate (CHEBI:2807) has functional parent hydroquinone O-β-D-glucopyranoside (CHEBI:18305) |
| hyemaloside A (CHEBI:66051) has functional parent hydroquinone O-β-D-glucopyranoside (CHEBI:18305) |
| hyemaloside C (CHEBI:66052) has functional parent hydroquinone O-β-D-glucopyranoside (CHEBI:18305) |
| IUPAC Name |
|---|
| 4-hydroxyphenyl β-D-glucopyranoside |
| Synonyms | Source |
|---|---|
| Arbutin | KEGG COMPOUND |
| Ursin | KEGG COMPOUND |
| Uvasol | KEGG COMPOUND |
| Hydroquinone-O-beta-D-glucopyranoside | KEGG COMPOUND |
| p-hydroxyphenyl β-D-glucopyranoside | ChemIDplus |
| p-hydroxyphenyl β-D-glucoside | ChemIDplus |
| UniProt Name | Source |
|---|---|
| arbutin | UniProt |
| Manual Xrefs | Databases |
|---|---|
| C06186 | KEGG COMPOUND |
| HMDB0029943 | HMDB |
| C00002638 | KNApSAcK |
| Arbutin | Wikipedia |
| HYDROQUINONE-O-BETA-D-GLUCOPYRANOSIDE | MetaCyc |
| LSM-5255 | LINCS |
| 4267 | DrugCentral |
| Registry Numbers | Sources |
|---|---|
| Reaxys:89673 | Reaxys |
| CAS:497-76-7 | KEGG COMPOUND |
| CAS:497-76-7 | ChemIDplus |
| Citations |
|---|