EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C12H17O10P |
| Net Charge | 0 |
| Average Mass | 352.232 |
| Monoisotopic Mass | 352.05593 |
| SMILES | O=P(O)(O)OC[C@H]1O[C@@H](Oc2ccc(O)cc2)[C@H](O)[C@@H](O)[C@@H]1O |
| InChI | InChI=1S/C12H17O10P/c13-6-1-3-7(4-2-6)21-12-11(16)10(15)9(14)8(22-12)5-20-23(17,18)19/h1-4,8-16H,5H2,(H2,17,18,19)/t8-,9-,10+,11-,12-/m1/s1 |
| InChIKey | FBHYCDOVYMVLEN-RMPHRYRLSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Escherichia coli (ncbitaxon:562) | - | PubMed (21988831) |
| Roles Classification |
|---|
| Biological Role: | Escherichia coli metabolite Any bacterial metabolite produced during a metabolic reaction in Escherichia coli. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| arbutin 6-phosphate (CHEBI:2807) has functional parent D-glucopyranose 6-phosphate (CHEBI:4170) |
| arbutin 6-phosphate (CHEBI:2807) has functional parent D-glucose 6-phosphate (CHEBI:14314) |
| arbutin 6-phosphate (CHEBI:2807) has functional parent hydroquinone O-β-D-glucopyranoside (CHEBI:18305) |
| arbutin 6-phosphate (CHEBI:2807) has role Escherichia coli metabolite (CHEBI:76971) |
| arbutin 6-phosphate (CHEBI:2807) is a β-D-glucoside (CHEBI:22798) |
| arbutin 6-phosphate (CHEBI:2807) is conjugate acid of arbutin 6-phosphate(2-) (CHEBI:60929) |
| Incoming Relation(s) |
| arbutin 6-phosphate(2-) (CHEBI:60929) is conjugate base of arbutin 6-phosphate (CHEBI:2807) |
| IUPAC Name |
|---|
| 4-hydroxyphenyl 6-O-phosphono-β-D-glucopyranoside |
| Synonyms | Source |
|---|---|
| Arbutin-6P | KEGG COMPOUND |
| Arbutin 6-phosphate | KEGG COMPOUND |
| Manual Xrefs | Databases |
|---|---|
| C06187 | KEGG COMPOUND |