EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C40H30O23 |
| Net Charge | 0 |
| Average Mass | 878.657 |
| Monoisotopic Mass | 878.11779 |
| SMILES | O=C(O[C@@H]1[C@@H](OC(=O)c2cc(O)c(O)c(O)c2)[C@H](Oc2ccc(O)cc2)O[C@@H]2COC(=O)c3cc(O)c(O)c(O)c3-c3c(cc(O)c(O)c3O)C(=O)O[C@@H]12)c1cc(O)c(O)c(O)c1 |
| InChI | InChI=1S/C40H30O23/c41-14-1-3-15(4-2-14)59-40-35(63-37(55)13-7-20(44)28(49)21(45)8-13)34(62-36(54)12-5-18(42)27(48)19(43)6-12)33-24(60-40)11-58-38(56)16-9-22(46)29(50)31(52)25(16)26-17(39(57)61-33)10-23(47)30(51)32(26)53/h1-10,24,33-35,40-53H,11H2/t24-,33-,34+,35-,40-/m1/s1 |
| InChIKey | BIUWKTLZFMHRQE-RYQQTUIDSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Eugenia hyemalis (IPNI:594680-1) | whole plant (BTO:0001461) | PubMed (18763827) | Whole plant without roots |
| Roles Classification |
|---|
| Biological Roles: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. EC 3.1.26.13 (retroviral ribonuclease H) inhibitor An inhibitor of ribonuclease H (EC 3.1.26.13), an enzyme required for specific hydrolysis of the RNA strand of an RNA/DNA hybrid. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| hyemaloside C (CHEBI:66052) has functional parent hydroquinone O-β-D-glucopyranoside (CHEBI:18305) |
| hyemaloside C (CHEBI:66052) has role EC 3.1.26.13 (retroviral ribonuclease H) inhibitor (CHEBI:52629) |
| hyemaloside C (CHEBI:66052) has role metabolite (CHEBI:25212) |
| hyemaloside C (CHEBI:66052) is a gallate ester (CHEBI:37576) |
| hyemaloside C (CHEBI:66052) is a β-D-glucoside (CHEBI:22798) |
| IUPAC Name |
|---|
| (11aR,13S,14R,15S,15aR)-2,3,4,5,6,7-hexahydroxy-13-(4-hydroxyphenoxy)-9,17-dioxo-9,11,11a,13,14,15,15a,17-octahydrodibenzo[g,i]pyrano[3,2-b][1,5]dioxacycloundecine-14,15-diyl bis(3,4,5-trihydroxybenzoate) |
| Registry Numbers | Sources |
|---|---|
| Reaxys:19205164 | Reaxys |
| Citations |
|---|