EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C40H30O23 |
| Net Charge | 0 |
| Average Mass | 878.657 |
| Monoisotopic Mass | 878.11779 |
| SMILES | O=C(O[C@@H]1[C@@H](OC(=O)c2cc(O)c(O)c(O)c2)[C@H](Oc2ccc(O)cc2)O[C@@H]2COC(=O)c3cc(O)c(O)c(O)c3-c3c(cc(O)c(O)c3O)C(=O)O[C@@H]12)c1cc(O)c(O)c(O)c1 |
| InChI | InChI=1S/C40H30O23/c41-14-1-3-15(4-2-14)59-40-35(63-37(55)13-7-20(44)28(49)21(45)8-13)34(62-36(54)12-5-18(42)27(48)19(43)6-12)33-24(60-40)11-58-38(56)16-9-22(46)29(50)31(52)25(16)26-17(39(57)61-33)10-23(47)30(51)32(26)53/h1-10,24,33-35,40-53H,11H2/t24-,33-,34+,35-,40-/m1/s1 |
| InChIKey | BIUWKTLZFMHRQE-RYQQTUIDSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Eugenia hyemalis (IPNI:594680-1) | whole plant (BTO:0001461) | PubMed (18763827) | Whole plant without roots |
| Roles Classification |
|---|
| Biological Roles: | EC 3.1.26.13 (retroviral ribonuclease H) inhibitor An inhibitor of ribonuclease H (EC 3.1.26.13), an enzyme required for specific hydrolysis of the RNA strand of an RNA/DNA hybrid. metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| hyemaloside C (CHEBI:66052) has functional parent hydroquinone O-β-D-glucopyranoside (CHEBI:18305) |
| hyemaloside C (CHEBI:66052) has role EC 3.1.26.13 (retroviral ribonuclease H) inhibitor (CHEBI:52629) |
| hyemaloside C (CHEBI:66052) has role metabolite (CHEBI:25212) |
| hyemaloside C (CHEBI:66052) is a gallate ester (CHEBI:37576) |
| hyemaloside C (CHEBI:66052) is a β-D-glucoside (CHEBI:22798) |
| IUPAC Name |
|---|
| (11aR,13S,14R,15S,15aR)-2,3,4,5,6,7-hexahydroxy-13-(4-hydroxyphenoxy)-9,17-dioxo-9,11,11a,13,14,15,15a,17-octahydrodibenzo[g,i]pyrano[3,2-b][1,5]dioxacycloundecine-14,15-diyl bis(3,4,5-trihydroxybenzoate) |
| Registry Numbers | Sources |
|---|---|
| Reaxys:19205164 | Reaxys |
| Citations |
|---|