EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C6H6O2 |
| Net Charge | 0 |
| Average Mass | 110.112 |
| Monoisotopic Mass | 110.03678 |
| SMILES | Oc1ccc(O)cc1 |
| InChI | InChI=1S/C6H6O2/c7-5-1-2-6(8)4-3-5/h1-4,7-8H |
| InChIKey | QIGBRXMKCJKVMJ-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Escherichia coli (ncbitaxon:562) | - | PubMed (21988831) | |
| Mus musculus (ncbitaxon:10090) | - | PubMed (19425150) | Source: BioModels - MODEL1507180067 |
| Roles Classification |
|---|
| Chemical Role: | antioxidant A substance that opposes oxidation or inhibits reactions brought about by dioxygen or peroxides. |
| Biological Roles: | human xenobiotic metabolite Any human metabolite produced by metabolism of a xenobiotic compound in humans. cofactor An organic molecule or ion (usually a metal ion) that is required by an enzyme for its activity. It may be attached either loosely (coenzyme) or tightly (prosthetic group). carcinogenic agent A role played by a chemical compound which is known to induce a process of carcinogenesis by corrupting normal cellular pathways, leading to the acquistion of tumoral capabilities. mouse metabolite Any mammalian metabolite produced during a metabolic reaction in a mouse (Mus musculus). Escherichia coli metabolite Any bacterial metabolite produced during a metabolic reaction in Escherichia coli. |
| Application: | skin lightening agent Any cosmetic used to lighten the colour of skin by reducing the concentration of melanin. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| hydroquinone (CHEBI:17594) has role Escherichia coli metabolite (CHEBI:76971) |
| hydroquinone (CHEBI:17594) has role antioxidant (CHEBI:22586) |
| hydroquinone (CHEBI:17594) has role carcinogenic agent (CHEBI:50903) |
| hydroquinone (CHEBI:17594) has role cofactor (CHEBI:23357) |
| hydroquinone (CHEBI:17594) has role human xenobiotic metabolite (CHEBI:76967) |
| hydroquinone (CHEBI:17594) has role mouse metabolite (CHEBI:75771) |
| hydroquinone (CHEBI:17594) has role skin lightening agent (CHEBI:85046) |
| hydroquinone (CHEBI:17594) is a benzenediol (CHEBI:17701) |
| hydroquinone (CHEBI:17594) is a hydroquinones (CHEBI:24646) |
| Incoming Relation(s) |
| 2,5-dihydroxybenzenesulfonic acid (CHEBI:71157) has functional parent hydroquinone (CHEBI:17594) |
| 2,6-dibromohydroquinone (CHEBI:19390) has functional parent hydroquinone (CHEBI:17594) |
| 4-hydroxyphenyl acetate (CHEBI:31128) has functional parent hydroquinone (CHEBI:17594) |
| chlorohydroquinones (CHEBI:23147) has functional parent hydroquinone (CHEBI:17594) |
| gentisyl alcohol (CHEBI:5325) has functional parent hydroquinone (CHEBI:17594) |
| hydroquinone O-β-D-glucopyranoside (CHEBI:18305) has functional parent hydroquinone (CHEBI:17594) |
| monobenzone (CHEBI:34380) has functional parent hydroquinone (CHEBI:17594) |
| quinol sulfate (CHEBI:71062) has functional parent hydroquinone (CHEBI:17594) |
| quinhydrone (CHEBI:26491) has part hydroquinone (CHEBI:17594) |
| IUPAC Name |
|---|
| benzene-1,4-diol |
| Synonyms | Source |
|---|---|
| 1,4-Benzenediol | KEGG COMPOUND |
| 1,4-Dihydroxybenzene | KEGG COMPOUND |
| 4-Hydroxyphenol | KEGG COMPOUND |
| Benzene-1,4-diol | KEGG COMPOUND |
| Eldoquin | ChemIDplus |
| p-hydroxyphenol | NIST Chemistry WebBook |
| UniProt Name | Source |
|---|---|
| hydroquinone | UniProt |
| Manual Xrefs | Databases |
|---|---|
| 1503 | PPDB |
| 3282 | DrugCentral |
| C00002656 | KNApSAcK |
| C00530 | KEGG COMPOUND |
| c0091 | UM-BBD |
| C15603 | KEGG COMPOUND |
| D00073 | KEGG DRUG |
| HMDB0002434 | HMDB |
| Hydroquinone | Wikipedia |
| HYDROQUINONE | MetaCyc |
| Citations |
|---|