EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:66051 - hyemaloside A
| Formula | C33H28O19 |
| Net Charge | 0 |
| Average Mass | 728.568 |
| Monoisotopic Mass | 728.12248 |
| SMILES | O=C(OC[C@H]1O[C@@H](Oc2ccc(O)cc2)[C@H](OC(=O)c2cc(O)c(O)c(O)c2)[C@@H](OC(=O)c2cc(O)c(O)c(O)c2)[C@@H]1O)c1cc(O)c(O)c(O)c1 |
| InChI | InChI=1S/C33H28O19/c34-15-1-3-16(4-2-15)49-33-29(52-32(47)14-9-21(39)26(43)22(40)10-14)28(51-31(46)13-7-19(37)25(42)20(38)8-13)27(44)23(50-33)11-48-30(45)12-5-17(35)24(41)18(36)6-12/h1-10,23,27-29,33-44H,11H2/t23-,27-,28+,29-,33-/m1/s1 |
| InChIKey | DTLDDZWHEMEXCO-ILYYIXHASA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Eugenia hyemalis (IPNI:594680-1) | whole plant (BTO:0001461) | PubMed (18763827) | Whole plant without roots |
| Roles Classification |
|---|
| Biological Roles: | EC 3.1.26.13 (retroviral ribonuclease H) inhibitor An inhibitor of ribonuclease H (EC 3.1.26.13), an enzyme required for specific hydrolysis of the RNA strand of an RNA/DNA hybrid. metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| hyemaloside A (CHEBI:66051) has functional parent hydroquinone O-β-D-glucopyranoside (CHEBI:18305) |
| hyemaloside A (CHEBI:66051) has role EC 3.1.26.13 (retroviral ribonuclease H) inhibitor (CHEBI:52629) |
| hyemaloside A (CHEBI:66051) has role metabolite (CHEBI:25212) |
| hyemaloside A (CHEBI:66051) is a gallate ester (CHEBI:37576) |
| hyemaloside A (CHEBI:66051) is a β-D-glucoside (CHEBI:22798) |
| IUPAC Name |
|---|
| 4-hydroxyphenyl 2,3,6-tris-O-(3,4,5-trihydroxybenzoyl)-β-D-glucopyranoside |
| Synonym | Source |
|---|---|
| 2,3,6-tri-O-galloylarbutin | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Reaxys:19205163 | Reaxys |
| Citations |
|---|