EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C11H12N2O2 |
| Net Charge | +1 |
| Average Mass | 204.229 |
| Monoisotopic Mass | 204.08933 |
| SMILES | NC(CC1=C[NH+]c2ccccc21)C(=O)O |
| InChI | InChI=1S/C11H12N2O2/c12-9(11(14)15)5-7-6-13-10-4-2-1-3-8(7)10/h1-4,6,9,13H,5,12H2,(H,14,15)/q+1 |
| InChIKey | HVGYHDAURCWJGF-UHFFFAOYSA-N |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| tryptophanyl radical cation (CHEBI:32729) has functional parent tryptophan (CHEBI:27897) |
| tryptophanyl radical cation (CHEBI:32729) is a α-amino-acid radical cation (CHEBI:36901) |
| tryptophanyl radical cation (CHEBI:32729) is conjugate acid of tryptophanyl radical (CHEBI:32730) |
| Incoming Relation(s) |
| D-tryptophanyl radical cation (CHEBI:32724) is a tryptophanyl radical cation (CHEBI:32729) |
| L-tryptophanyl radical cation (CHEBI:32713) is a tryptophanyl radical cation (CHEBI:32729) |
| tryptophanyl radical (CHEBI:32730) is conjugate base of tryptophanyl radical cation (CHEBI:32729) |
| tryptophanyl radical cation residue (CHEBI:32734) is substituent group from tryptophanyl radical cation (CHEBI:32729) |
| IUPAC Name |
|---|
| 3-(2-amino-2-carboxyethyl)-1H-indol-1-ium-1-yl |
| Synonyms | Source |
|---|---|
| Htrp•+ | IUPAC |
| tryptophan(•1+) | ChEBI |
| tryptophan cation radical | ChEBI |
| tryptophan radical cation | ChEBI |
| tryptophanyl cation radical | ChEBI |