EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C11H11N2O2 |
| Net Charge | -1 |
| Average Mass | 203.221 |
| Monoisotopic Mass | 203.08260 |
| SMILES | NC(Cc1cnc2ccccc12)C(=O)[O-] |
| InChI | InChI=1S/C11H12N2O2/c12-9(11(14)15)5-7-6-13-10-4-2-1-3-8(7)10/h1-4,6,9,13H,5,12H2,(H,14,15)/p-1 |
| InChIKey | QIVBCDIJIAJPQS-UHFFFAOYSA-M |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| tryptophanate (CHEBI:32727) is a α-amino-acid anion (CHEBI:33558) |
| tryptophanate (CHEBI:32727) is conjugate base of tryptophan (CHEBI:27897) |
| Incoming Relation(s) |
| D-tryptophanate (CHEBI:32716) is a tryptophanate (CHEBI:32727) |
| L-tryptophanate (CHEBI:32702) is a tryptophanate (CHEBI:32727) |
| tryptophan (CHEBI:27897) is conjugate acid of tryptophanate (CHEBI:32727) |
| IUPAC Name |
|---|
| tryptophanate |
| Synonyms | Source |
|---|---|
| 2-amino-3-(1H-indol-3-yl)propanoate | IUPAC |
| trp− | IUPAC |
| tryptophan anion | JCBN |
| Registry Numbers | Sources |
|---|---|
| Gmelin:331342 | Gmelin |
| Beilstein:4144997 | Beilstein |
| Reaxys:4144998 | Reaxys |