EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C11H13N2O2 |
| Net Charge | +1 |
| Average Mass | 205.237 |
| Monoisotopic Mass | 205.09715 |
| SMILES | [NH3+]C(Cc1cnc2ccccc12)C(=O)O |
| InChI | InChI=1S/C11H12N2O2/c12-9(11(14)15)5-7-6-13-10-4-2-1-3-8(7)10/h1-4,6,9,13H,5,12H2,(H,14,15)/p+1 |
| InChIKey | QIVBCDIJIAJPQS-UHFFFAOYSA-O |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| tryptophanium (CHEBI:32728) is a α-amino-acid cation (CHEBI:33719) |
| tryptophanium (CHEBI:32728) is conjugate acid of tryptophan (CHEBI:27897) |
| Incoming Relation(s) |
| D-tryptophanium (CHEBI:32717) is a tryptophanium (CHEBI:32728) |
| L-tryptophanium (CHEBI:32704) is a tryptophanium (CHEBI:32728) |
| tryptophan (CHEBI:27897) is conjugate base of tryptophanium (CHEBI:32728) |
| IUPAC Name |
|---|
| tryptophanium |
| Synonyms | Source |
|---|---|
| 1-carboxy-2-(1H-indol-3-yl)ethanaminium | IUPAC |
| Htrp+ | IUPAC |
| tryptophan cation | JCBN |