EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C14H26O2 |
| Net Charge | 0 |
| Average Mass | 226.360 |
| Monoisotopic Mass | 226.19328 |
| SMILES | CCCC/C=C\CCCCCCCC(=O)O |
| InChI | InChI=1S/C14H26O2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14(15)16/h5-6H,2-4,7-13H2,1H3,(H,15,16)/b6-5- |
| InChIKey | YWWVWXASSLXJHU-WAYWQWQTSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Roles: | EC 3.1.1.1 (carboxylesterase) inhibitor Any EC 3.1.1.* (carboxylic ester hydrolase) inhibitor that inhibits the action of carboxylesterase (EC 3.1.1.1 ). apoptosis inducer Any substance that induces the process of apoptosis (programmed cell death) in multi-celled organisms. plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| myristoleic acid (CHEBI:27781) has role apoptosis inducer (CHEBI:68495) |
| myristoleic acid (CHEBI:27781) has role EC 3.1.1.1 (carboxylesterase) inhibitor (CHEBI:78444) |
| myristoleic acid (CHEBI:27781) has role plant metabolite (CHEBI:76924) |
| myristoleic acid (CHEBI:27781) is a long-chain fatty acid (CHEBI:15904) |
| myristoleic acid (CHEBI:27781) is a tetradecenoic acid (CHEBI:36004) |
| myristoleic acid (CHEBI:27781) is conjugate acid of myristoleate (CHEBI:32370) |
| Incoming Relation(s) |
| (9Z)-myristoleoyl-CoA (CHEBI:65087) has functional parent myristoleic acid (CHEBI:27781) |
| (9Z)-myristoleoyl-CoA(4−) (CHEBI:65060) has functional parent myristoleic acid (CHEBI:27781) |
| O-[(9Z)-tetradecenoyl]-L-carnitine (CHEBI:84647) has functional parent myristoleic acid (CHEBI:27781) |
| 1-[(9Z)-hexadecenoyl]-2-[(9Z)-tetradecenoyl]-sn-glycero-3-phosphocholine (CHEBI:86415) has functional parent myristoleic acid (CHEBI:27781) |
| 1-[(9Z)-hexadecenyl]--[(9Z)-tetradecenoyl]-sn-glycero-3-phosphocholine (CHEBI:86423) has functional parent myristoleic acid (CHEBI:27781) |
| 1-[(9Z)-tetradecenoyl]-2-[(5Z,8Z,11Z,14Z)-icosatetraenoyl]-sn-glycerol (CHEBI:86977) has functional parent myristoleic acid (CHEBI:27781) |
| 1,2-dimyristoleoyl-sn-glycerol (CHEBI:84702) has functional parent myristoleic acid (CHEBI:27781) |
| myristoleamide (CHEBI:146161) has functional parent myristoleic acid (CHEBI:27781) |
| myristoleate (CHEBI:32370) is conjugate base of myristoleic acid (CHEBI:27781) |
| myristoleoyl group (CHEBI:32371) is substituent group from myristoleic acid (CHEBI:27781) |
| IUPAC Name |
|---|
| (9Z)-tetradec-9-enoic acid |
| Synonyms | Source |
|---|---|
| 9Z-tetradecenoic acid | ChEBI |
| 9-Tetradecenoic acid | KEGG COMPOUND |
| (9Z)-Tetradecenoic acid | KEGG COMPOUND |
| cis-9-tetradecenoic acid | ChEBI |
| cis-tetradec-9-enoic acid | ChEBI |
| cis-Δ9-tetradecenoic acid | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| C00001229 | KNApSAcK |
| C08322 | KEGG COMPOUND |
| HMDB0002000 | HMDB |
| LMFA01030051 | LIPID MAPS |
| Myristoleic_acid | Wikipedia |
| Registry Numbers | Sources |
|---|---|
| Reaxys:1724311 | Reaxys |
| CAS:544-64-9 | KEGG COMPOUND |
| CAS:544-64-9 | ChemIDplus |
| Citations |
|---|