EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C35H60N7O17P3S |
| Net Charge | 0 |
| Average Mass | 975.886 |
| Monoisotopic Mass | 975.29792 |
| SMILES | CCCC/C=C\CCCCCCCC(=O)SCCNC(=O)CCNC(=O)[C@H](O)C(C)(C)COP(=O)(O)OP(=O)(O)OC[C@H]1O[C@@H](n2cnc3c(N)ncnc32)[C@H](O)[C@@H]1OP(=O)(O)O |
| InChI | InChI=1S/C35H60N7O17P3S/c1-4-5-6-7-8-9-10-11-12-13-14-15-26(44)63-19-18-37-25(43)16-17-38-33(47)30(46)35(2,3)21-56-62(53,54)59-61(51,52)55-20-24-29(58-60(48,49)50)28(45)34(57-24)42-23-41-27-31(36)39-22-40-32(27)42/h7-8,22-24,28-30,34,45-46H,4-6,9-21H2,1-3H3,(H,37,43)(H,38,47)(H,51,52)(H,53,54)(H2,36,39,40)(H2,48,49,50)/b8-7-/t24-,28-,29-,30+,34-/m1/s1 |
| InChIKey | GIIFECKTWKZXGU-FJXLYLFVSA-N |
| Roles Classification |
|---|
| Chemical Role: | acyl donor Any donor that can transfer acyl groups between molecular entities. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (9Z)-myristoleoyl-CoA (CHEBI:65087) has functional parent myristoleic acid (CHEBI:27781) |
| (9Z)-myristoleoyl-CoA (CHEBI:65087) is a monounsaturated fatty acyl-CoA (CHEBI:139575) |
| (9Z)-myristoleoyl-CoA (CHEBI:65087) is conjugate acid of (9Z)-myristoleoyl-CoA(4−) (CHEBI:65060) |
| Incoming Relation(s) |
| (9Z)-myristoleoyl-CoA(4−) (CHEBI:65060) is conjugate base of (9Z)-myristoleoyl-CoA (CHEBI:65087) |
| IUPAC Name |
|---|
| 3'-phosphoadenosine 5'-{3-[(3R)-3-hydroxy-2,2-dimethyl-4-oxo-4-({3-oxo-3-[(2-{[(9Z)-tetradec-9-enoyl]sulfanyl}ethyl)amino]propyl}amino)butyl] dihydrogen diphosphate} |
| Synonyms | Source |
|---|---|
| (9Z)-myristoleoyl-coenzyme A | ChEBI |
| cis-tetradec-9-enoyl-CoA | ChEBI |
| cis-tetradec-9-enoyl-coenzyme A | ChEBI |
| (Z)-tetradec-9-enoyl-CoA | ChEBI |
| (Z)-tetradec-9-enoyl-coenzyme A | ChEBI |
| myristoleoyl-CoA | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Reaxys:9836159 | Reaxys |
| Citations |
|---|