EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C14H25O2 |
| Net Charge | -1 |
| Average Mass | 225.352 |
| Monoisotopic Mass | 225.18600 |
| SMILES | CCCC/C=C\CCCCCCCC(=O)[O-] |
| InChI | InChI=1S/C14H26O2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14(15)16/h5-6H,2-4,7-13H2,1H3,(H,15,16)/p-1/b6-5- |
| InChIKey | YWWVWXASSLXJHU-WAYWQWQTSA-M |
| Roles Classification |
|---|
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| myristoleate (CHEBI:32370) has role plant metabolite (CHEBI:76924) |
| myristoleate (CHEBI:32370) is a tetradecenoate (CHEBI:78896) |
| myristoleate (CHEBI:32370) is conjugate base of myristoleic acid (CHEBI:27781) |
| Incoming Relation(s) |
| myristoleic acid (CHEBI:27781) is conjugate acid of myristoleate (CHEBI:32370) |
| IUPAC Name |
|---|
| (9Z)-tetradec-9-enoate |
| Synonyms | Source |
|---|---|
| (14:1n5) | ChEBI |
| (9Z)-tetradecenoate | ChEBI |
| 9Z-tetradecenoate | ChEBI |
| 9-tetradecenoate | ChEBI |
| cis-9-tetradecenoate | ChEBI |
| cis-Δ9-tetradecenoate | ChEBI |
| UniProt Name | Source |
|---|---|
| (9Z)-tetradecenoate | UniProt |
| Registry Numbers | Sources |
|---|---|
| Reaxys:6391251 | Reaxys |