EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C8H18N6O4 |
| Net Charge | 0 |
| Average Mass | 262.270 |
| Monoisotopic Mass | 262.13895 |
| SMILES | N=C(N)N[C@@H]1[C@@H](O)[C@H](NC(=N)N)[C@@H](O)[C@H](O)[C@H]1O |
| InChI | InChI=1S/C8H18N6O4/c9-7(10)13-1-3(15)2(14-8(11)12)5(17)6(18)4(1)16/h1-6,15-18H,(H4,9,10,13)(H4,11,12,14)/t1-,2+,3-,4+,5-,6- |
| InChIKey | MSXMXWJPFIDEMT-FAEUDGQSSA-N |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| streptidine (CHEBI:27405) has functional parent scyllo-inositol (CHEBI:10642) |
| streptidine (CHEBI:27405) has role metabolite (CHEBI:25212) |
| streptidine (CHEBI:27405) is a amino cyclitol (CHEBI:61689) |
| streptidine (CHEBI:27405) is a guanidines (CHEBI:24436) |
| streptidine (CHEBI:27405) is conjugate base of streptidine(2+) (CHEBI:184376) |
| Incoming Relation(s) |
| O-(1→4)-α-L-dihydrostreptosylstreptidine 6-phosphate (CHEBI:17265) has functional parent streptidine (CHEBI:27405) |
| 2-deoxystreptidine (CHEBI:28248) has functional parent streptidine (CHEBI:27405) |
| streptidine 6-phosphate (CHEBI:17913) has functional parent streptidine (CHEBI:27405) |
| streptomycin (CHEBI:17076) has functional parent streptidine (CHEBI:27405) |
| streptidine(2+) (CHEBI:184376) is conjugate acid of streptidine (CHEBI:27405) |
| IUPAC Names |
|---|
| N,N'''-[(1R,2s,3S,4R,5r,6S)-2,4,5,6-tetrahydroxycyclohexane-1,3-diyl]diguanidine |
| 1,1'-[(1R,2s,3S,4R,5r,6S)-2,4,5,6-tetrahydroxycyclohexane-1,3-diyl]diguanidine |
| Synonyms | Source |
|---|---|
| Streptidine | KEGG COMPOUND |
| 1,1'-(2,4,5,6-Tetrahydroxy-1,3-cyclohexylene)diguanidine | ChemIDplus |
| Streptamine, N,N'-bis(aminoiminomethyl)- | ChemIDplus |
| N,N'-diamidinostreptamine | ChEBI |
| 1,3-diguanidino-2,4,5,6-cyclohexanetetrol | ChEBI |
| N,N'-bis(aminoiminomethyl)streptamine | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| C00837 | KEGG COMPOUND |
| CPD-10148 | MetaCyc |
| HMDB0258506 | HMDB |
| Registry Numbers | Sources |
|---|---|
| Reaxys:2816623 | Reaxys |
| CAS:85-17-6 | KEGG COMPOUND |
| CAS:85-17-6 | ChemIDplus |
| Citations |
|---|