EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C21H39N7O12 |
| Net Charge | 0 |
| Average Mass | 581.580 |
| Monoisotopic Mass | 581.26567 |
| SMILES | CN[C@@H]1[C@H](O[C@H]2[C@H](O[C@H]3[C@H](O)[C@@H](O)[C@H](NC(=N)N)[C@@H](O)[C@@H]3NC(=N)N)O[C@@H](C)[C@]2(O)C=O)O[C@@H](CO)[C@H](O)[C@H]1O |
| InChI | InChI=1S/C21H39N7O12/c1-5-21(36,4-30)16(40-17-9(26-2)13(34)10(31)6(3-29)38-17)18(37-5)39-15-8(28-20(24)25)11(32)7(27-19(22)23)12(33)14(15)35/h4-18,26,29,31-36H,3H2,1-2H3,(H4,22,23,27)(H4,24,25,28)/t5-,6-,7+,8-,9-,10-,11+,12-,13-,14+,15+,16-,17-,18-,21+/m0/s1 |
| InChIKey | UCSJYZPVAKXKNQ-HZYVHMACSA-N |
| Wikipedia |
|---|
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Streptomyces griseus (ncbitaxon:1911) | - | PubMed (22101040) |
| Roles Classification |
|---|
| Biological Roles: | antibacterial drug A drug used to treat or prevent bacterial infections. protein synthesis inhibitor A compound, usually an anti-bacterial agent or a toxin, which inhibits the synthesis of a protein. bacterial metabolite Any prokaryotic metabolite produced during a metabolic reaction in bacteria. antimicrobial drug A drug used to treat or prevent microbial infections. antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. antifungal agrochemical Any substance used in acriculture, horticulture, forestry, etc. for its fungicidal properties. antifungal drug Any antifungal agent used to prevent or treat fungal infections in humans or animals. antifungal agent An antimicrobial agent that destroys fungi by suppressing their ability to grow or reproduce. fungicide A substance used to destroy fungal pests. antifungal agent An antimicrobial agent that destroys fungi by suppressing their ability to grow or reproduce. antifungal agent An antimicrobial agent that destroys fungi by suppressing their ability to grow or reproduce. antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. |
| Applications: | antibacterial drug A drug used to treat or prevent bacterial infections. antimicrobial drug A drug used to treat or prevent microbial infections. antifungal agrochemical Any substance used in acriculture, horticulture, forestry, etc. for its fungicidal properties. antifungal drug Any antifungal agent used to prevent or treat fungal infections in humans or animals. fungicide A substance used to destroy fungal pests. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| streptomycin (CHEBI:17076) has functional parent streptidine (CHEBI:27405) |
| streptomycin (CHEBI:17076) has role antibacterial drug (CHEBI:36047) |
| streptomycin (CHEBI:17076) has role antifungal agrochemical (CHEBI:86328) |
| streptomycin (CHEBI:17076) has role antimicrobial agent (CHEBI:33281) |
| streptomycin (CHEBI:17076) has role antimicrobial drug (CHEBI:36043) |
| streptomycin (CHEBI:17076) has role bacterial metabolite (CHEBI:76969) |
| streptomycin (CHEBI:17076) has role protein synthesis inhibitor (CHEBI:48001) |
| streptomycin (CHEBI:17076) is a antibiotic antifungal drug (CHEBI:87113) |
| streptomycin (CHEBI:17076) is a antibiotic fungicide (CHEBI:87114) |
| streptomycin (CHEBI:17076) is a streptomycins (CHEBI:26788) |
| streptomycin (CHEBI:17076) is conjugate base of streptomycin(3+) (CHEBI:58007) |
| Incoming Relation(s) |
| 3''-adenylylstreptomycin (CHEBI:29076) has functional parent streptomycin (CHEBI:17076) |
| 5'-hydroxystreptomycin (CHEBI:24750) has functional parent streptomycin (CHEBI:17076) |
| streptomycin sulfate (CHEBI:32158) has functional parent streptomycin (CHEBI:17076) |
| streptomycin(3+) (CHEBI:58007) is conjugate acid of streptomycin (CHEBI:17076) |
| IUPAC Name |
|---|
| N,N'''-[(1R,2R,3S,4R,5R,6S)-4-{5-deoxy-2-O-[2-deoxy-2-(methylamino)-α-L-glucopyranosyl]-3-C-formyl-α-L-lyxofuranosyloxy}-2,5,6-trihydroxycyclohexane-1,3-diyl]diguanidine |
| INN | Source |
|---|---|
| streptomycin | KEGG DRUG |
| Synonyms | Source |
|---|---|
| [2-deoxy-2-(dimethylamino)-α-L-glucopyranosyl]-(1→2)-[5-deoxy-3-C-formyl-α-L-lyxofuranosyl]-(1→4)-{N',N'''-[(1,3,5/2,4,6)-2,4,5,6-tetrahydroxycyclohexane-1,3-diyl]diguanidine} | IUPAC |
| 2,4-Diguanidino-3,5,6-trihydroxycyclohexyl 5-deoxy-2-O-(2-deoxy-2-methylamino-alpha-L-glucopyranosyl)-3-C-formyl-beta-L-lyxopentanofuranoside | ChemIDplus |
| STREPTOMYCIN | PDBeChem |
| SM | KEGG DRUG |
| streomycin | ChEBI |
| Brand Name | Source |
|---|---|
| Kantrex | DrugBank |
| Manual Xrefs | Databases |
|---|---|
| C00413 | KEGG COMPOUND |
| SRY | PDBeChem |
| D08531 | KEGG DRUG |
| DB01082 | DrugBank |
| Streptomycin | Wikipedia |
| streptomycin | Alan Wood's Pesticides |
| HMDB0015214 | HMDB |
| STREPTOMYCIN | MetaCyc |
| 2481 | DrugCentral |
| Registry Numbers | Sources |
|---|---|
| Reaxys:74498 | Reaxys |
| CAS:57-92-1 | KEGG COMPOUND |
| CAS:57-92-1 | ChemIDplus |
| Citations |
|---|