EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C8H19N6O7P |
| Net Charge | 0 |
| Average Mass | 342.249 |
| Monoisotopic Mass | 342.10528 |
| SMILES | N=C(N)N[C@@H]1[C@@H](O)[C@H](O)[C@@H](OP(=O)(O)O)[C@H](NC(=N)N)[C@H]1O |
| InChI | InChI=1S/C8H19N6O7P/c9-7(10)13-1-3(15)2(14-8(11)12)6(5(17)4(1)16)21-22(18,19)20/h1-6,15-17H,(H4,9,10,13)(H4,11,12,14)(H2,18,19,20)/t1-,2+,3-,4+,5-,6-/m0/s1 |
| InChIKey | UUUGVWGQJIFFRM-FUHDGFEASA-N |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| streptidine 6-phosphate (CHEBI:17913) has functional parent streptidine (CHEBI:27405) |
| streptidine 6-phosphate (CHEBI:17913) is a scyllo-inositol phosphate (CHEBI:26613) |
| streptidine 6-phosphate (CHEBI:17913) is tautomer of streptidine 6-phosphate zwitterion (CHEBI:60106) |
| Incoming Relation(s) |
| streptidine 6-phosphate zwitterion (CHEBI:60106) is tautomer of streptidine 6-phosphate (CHEBI:17913) |
| IUPAC Name |
|---|
| (1S,2R,3S,4S,5R,6S)-2,4-bis(carbamimidamido)-3,5,6-trihydroxycyclohexyl dihydrogen phosphate |
| Synonyms | Source |
|---|---|
| Streptidine 6-phosphate | KEGG COMPOUND |
| Streptidine-6-phosphate | ChemIDplus |
| D-Streptamine, N,N'-bis(aminoiminomethyl)-, 6-(dihydrogen phosphate) | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| C01121 | KEGG COMPOUND |
| Registry Numbers | Sources |
|---|---|
| CAS:73679-08-0 | ChemIDplus |