EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C14H29N6O11P |
| Net Charge | 0 |
| Average Mass | 488.391 |
| Monoisotopic Mass | 488.16319 |
| SMILES | C[C@@H]1O[C@@H](O[C@H]2[C@H](O)[C@@H](OP(=O)(O)O)[C@H](NC(=N)N)[C@@H](O)[C@@H]2NC(=N)N)[C@H](O)[C@@]1(O)CO |
| InChI | InChI=1S/C14H29N6O11P/c1-3-14(25,2-21)10(24)11(29-3)30-8-4(19-12(15)16)6(22)5(20-13(17)18)9(7(8)23)31-32(26,27)28/h3-11,21-25H,2H2,1H3,(H4,15,16,19)(H4,17,18,20)(H2,26,27,28)/t3-,4-,5+,6-,7-,8+,9-,10-,11-,14+/m0/s1 |
| InChIKey | RUBKAAVMXLSLAZ-UVTYLADFSA-N |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| O-(1→4)-α-L-dihydrostreptosylstreptidine 6-phosphate (CHEBI:17265) has functional parent streptidine (CHEBI:27405) |
| O-(1→4)-α-L-dihydrostreptosylstreptidine 6-phosphate (CHEBI:17265) is a scyllo-inositol phosphate (CHEBI:26613) |
| O-(1→4)-α-L-dihydrostreptosylstreptidine 6-phosphate (CHEBI:17265) is tautomer of O-(1→4)-α-L-dihydrostreptosylstreptidine 6-phosphate zwitterion (CHEBI:58082) |
| Incoming Relation(s) |
| O-(1→4)-α-L-dihydrostreptosylstreptidine 6-phosphate zwitterion (CHEBI:58082) is tautomer of O-(1→4)-α-L-dihydrostreptosylstreptidine 6-phosphate (CHEBI:17265) |
| IUPAC Name |
|---|
| (1S,2R,3S,4S,5R,6S)-2,4-dicarbamimidamido-5-{[5-deoxy-3-C-(hydroxymethyl)-α-L-lyxofuranosyl]oxy}-3,6-dihydroxycyclohexyl dihydrogen phosphate |
| Synonyms | Source |
|---|---|
| DHSSP | ChemIDplus |
| Dihydrostreptosyl streptidine 6-phosphate | ChemIDplus |
| O-1,4-alpha-L-Dihydrostreptosyl-streptidine 6-phosphate | KEGG COMPOUND |
| Manual Xrefs | Databases |
|---|---|
| C04767 | KEGG COMPOUND |
| Registry Numbers | Sources |
|---|---|
| CAS:59719-49-2 | ChemIDplus |