EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:15702 - terephthalic acid
| Formula | C8H6O4 |
| Net Charge | 0 |
| Average Mass | 166.132 |
| Monoisotopic Mass | 166.02661 |
| SMILES | O=C(O)c1ccc(C(=O)O)cc1 |
| InChI | InChI=1S/C8H6O4/c9-7(10)5-1-2-6(4-3-5)8(11)12/h1-4H,(H,9,10)(H,11,12) |
| InChIKey | KKEYFWRCBNTPAC-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| terephthalic acid (CHEBI:15702) is a benzenedicarboxylic acid (CHEBI:26094) |
| terephthalic acid (CHEBI:15702) is conjugate acid of terephthalate(1−) (CHEBI:30801) |
| Incoming Relation(s) |
| 4-[(2-hydroxyethoxy)carbonyl]benzoic acid (CHEBI:131735) has functional parent terephthalic acid (CHEBI:15702) |
| 4-carbamoylbenzoic acid (CHEBI:50738) has functional parent terephthalic acid (CHEBI:15702) |
| dimethyl terephthalate (CHEBI:156286) has functional parent terephthalic acid (CHEBI:15702) |
| tamibarotene (CHEBI:32181) has functional parent terephthalic acid (CHEBI:15702) |
| terephthalamide (CHEBI:38802) has functional parent terephthalic acid (CHEBI:15702) |
| terephthalate(1−) (CHEBI:30801) is conjugate base of terephthalic acid (CHEBI:15702) |
| IUPAC Name |
|---|
| benzene-1,4-dicarboxylic acid |
| Synonyms | Source |
|---|---|
| Terephthalic acid | KEGG COMPOUND |
| 1,4-Benzenedicarboxylic acid | KEGG COMPOUND |
| terephthalic acid | IUPAC |
| p-benzenedicarboxylic acid | NIST Chemistry WebBook |
| TPA | NIST Chemistry WebBook |
| para-benzenedicarboxylic acid | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| C06337 | KEGG COMPOUND |
| TEREPHTHALATE | MetaCyc |
| HMDB0002428 | HMDB |
| Terephthalic_acid | Wikipedia |
| Citations |
|---|