EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C10H10O4 |
| Net Charge | 0 |
| Average Mass | 194.186 |
| Monoisotopic Mass | 194.05791 |
| SMILES | COC(=O)c1ccc(C(=O)OC)cc1 |
| InChI | InChI=1S/C10H10O4/c1-13-9(11)7-3-5-8(6-4-7)10(12)14-2/h3-6H,1-2H3 |
| InChIKey | WOZVHXUHUFLZGK-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Application: | endocrine disruptor Any compound that can disrupt the functions of the endocrine (hormone) system |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| dimethyl terephthalate (CHEBI:156286) has functional parent terephthalic acid (CHEBI:15702) |
| dimethyl terephthalate (CHEBI:156286) is a diester (CHEBI:51307) |
| dimethyl terephthalate (CHEBI:156286) is a methyl ester (CHEBI:25248) |
| dimethyl terephthalate (CHEBI:156286) is a phthalate ester (CHEBI:35484) |
| IUPAC Name |
|---|
| dimethyl benzene-1,4-dicarboxylate |
| Synonyms | Source |
|---|---|
| 1,4-benzenedicarboxylic acid, 1,4-dimethyl ester | ChemIDplus |
| 1,4-benzenedicarboxylic acid dimethyl ester | ChEBI |
| di-Me terephthalate | ChemIDplus |
| dimethyl 1,4-benzenedicarboxylate | ChemIDplus |
| dimethyl 4-phthalate | ChemIDplus |
| dimethyl p-benzenedicarboxylate | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| CPD-19189 | MetaCyc |
| Dimethyl_terephthalate | Wikipedia |
| Citations |
|---|