EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C8H5O4 |
| Net Charge | -1 |
| Average Mass | 165.124 |
| Monoisotopic Mass | 165.01933 |
| SMILES | O=C([O-])c1ccc(C(=O)O)cc1 |
| InChI | InChI=1S/C8H6O4/c9-7(10)5-1-2-6(4-3-5)8(11)12/h1-4H,(H,9,10)(H,11,12)/p-1 |
| InChIKey | KKEYFWRCBNTPAC-UHFFFAOYSA-M |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| terephthalate(1−) (CHEBI:30801) is a dicarboxylic acid monoanion (CHEBI:35695) |
| terephthalate(1−) (CHEBI:30801) is conjugate acid of terephthalate(2−) (CHEBI:30043) |
| terephthalate(1−) (CHEBI:30801) is conjugate base of terephthalic acid (CHEBI:15702) |
| Incoming Relation(s) |
| terephthalic acid (CHEBI:15702) is conjugate acid of terephthalate(1−) (CHEBI:30801) |
| terephthalate(2−) (CHEBI:30043) is conjugate base of terephthalate(1−) (CHEBI:30801) |
| IUPAC Name |
|---|
| 4-carboxybenzoate |
| Synonym | Source |
|---|---|
| hydrogen terephthalate | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Gmelin:328026 | Gmelin |
| Beilstein:3590108 | Beilstein |