EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C8H7NO3 |
| Net Charge | 0 |
| Average Mass | 165.148 |
| Monoisotopic Mass | 165.04259 |
| SMILES | NC(=O)c1ccc(C(=O)O)cc1 |
| InChI | InChI=1S/C8H7NO3/c9-7(10)5-1-3-6(4-2-5)8(11)12/h1-4H,(H2,9,10)(H,11,12) |
| InChIKey | JMHSCWJIDIKGNZ-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 4-carbamoylbenzoic acid (CHEBI:50738) has functional parent terephthalic acid (CHEBI:15702) |
| 4-carbamoylbenzoic acid (CHEBI:50738) is a carbamoylbenzoic acid (CHEBI:50735) |
| 4-carbamoylbenzoic acid (CHEBI:50738) is a dicarboxylic acid monoamide (CHEBI:35735) |
| Incoming Relation(s) |
| tamibarotene (CHEBI:32181) has functional parent 4-carbamoylbenzoic acid (CHEBI:50738) |
| IUPAC Name |
|---|
| 4-carbamoylbenzoic acid |
| Synonym | Source |
|---|---|
| 4-(aminocarbonyl)benzoic acid | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Reaxys:387658 | Reaxys |