EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C22H25NO3 |
| Net Charge | 0 |
| Average Mass | 351.446 |
| Monoisotopic Mass | 351.18344 |
| SMILES | CC1(C)CCC(C)(C)c2cc(NC(=O)c3ccc(C(=O)O)cc3)ccc21 |
| InChI | InChI=1S/C22H25NO3/c1-21(2)11-12-22(3,4)18-13-16(9-10-17(18)21)23-19(24)14-5-7-15(8-6-14)20(25)26/h5-10,13H,11-12H2,1-4H3,(H,23,24)(H,25,26) |
| InChIKey | MUTNCGKQJGXKEM-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Role: | retinoic acid receptor alpha/beta agonist Any retinoic acid receptor (RAR) agonist with specificity for RARα and RARβ. |
| Applications: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. retinoic acid receptor alpha/beta agonist Any retinoic acid receptor (RAR) agonist with specificity for RARα and RARβ. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| tamibarotene (CHEBI:32181) has functional parent 4-carbamoylbenzoic acid (CHEBI:50738) |
| tamibarotene (CHEBI:32181) has functional parent terephthalic acid (CHEBI:15702) |
| tamibarotene (CHEBI:32181) has role antineoplastic agent (CHEBI:35610) |
| tamibarotene (CHEBI:32181) has role retinoic acid receptor α/β agonist (CHEBI:50741) |
| tamibarotene (CHEBI:32181) is a dicarboxylic acid monoamide (CHEBI:35735) |
| tamibarotene (CHEBI:32181) is a retinoid (CHEBI:26537) |
| tamibarotene (CHEBI:32181) is a tetralins (CHEBI:36786) |
| IUPAC Name |
|---|
| 4-[(5,5,8,8-tetramethyl-5,6,7,8-tetrahydronaphthalen-2-yl)carbamoyl]benzoic acid |
| Synonyms | Source |
|---|---|
| Am 80 | KEGG COMPOUND |
| Am-80 | ChEBI |
| retinobenzoic acid | DrugBank |
| Tamibarotene | KEGG COMPOUND |
| Brand Names | Source |
|---|---|
| Amnoid | DrugBank |
| Tamibaro | DrugBank |
| Manual Xrefs | Databases |
|---|---|
| 3580 | DrugCentral |
| A80 | PDBeChem |
| C12864 | KEGG COMPOUND |
| D01418 | KEGG DRUG |
| DB04942 | DrugBank |
| HMDB0015605 | HMDB |
| LSM-5493 | LINCS |
| Tamibarotene | Wikipedia |
| Registry Numbers | Sources |
|---|---|
| Reaxys:3564473 | Reaxys |
| CAS:94497-51-5 | KEGG COMPOUND |
| CAS:94497-51-5 | ChemIDplus |
| Citations |
|---|