EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C7H10O5 |
| Net Charge | 0 |
| Average Mass | 174.152 |
| Monoisotopic Mass | 174.05282 |
| SMILES | O=C(O)C1=C[C@@H](O)[C@@H](O)[C@H](O)C1 |
| InChI | InChI=1S/C7H10O5/c8-4-1-3(7(11)12)2-5(9)6(4)10/h1,4-6,8-10H,2H2,(H,11,12)/t4-,5-,6-/m1/s1 |
| InChIKey | JXOHGGNKMLTUBP-HSUXUTPPSA-N |
| Wikipedia |
|---|
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Escherichia coli (ncbitaxon:562) | |||
| - | PubMed (24783849) | ||
| - | PubMed (21988831) | ||
| Saccharomyces cerevisiae (ncbitaxon:4932) | - | PubMed (24981409) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Roles: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. Saccharomyces cerevisiae metabolite Any fungal metabolite produced during a metabolic reaction in Baker's yeast (Saccharomyces cerevisiae ). Escherichia coli metabolite Any bacterial metabolite produced during a metabolic reaction in Escherichia coli. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| shikimic acid (CHEBI:16119) has role Escherichia coli metabolite (CHEBI:76971) |
| shikimic acid (CHEBI:16119) has role Saccharomyces cerevisiae metabolite (CHEBI:75772) |
| shikimic acid (CHEBI:16119) has role plant metabolite (CHEBI:76924) |
| shikimic acid (CHEBI:16119) is a cyclohexenecarboxylic acid (CHEBI:23483) |
| shikimic acid (CHEBI:16119) is a hydroxy monocarboxylic acid (CHEBI:35868) |
| shikimic acid (CHEBI:16119) is a α,β-unsaturated monocarboxylic acid (CHEBI:79020) |
| shikimic acid (CHEBI:16119) is conjugate acid of shikimate (CHEBI:36208) |
| Incoming Relation(s) |
| (3R,4S,5R)-4,5-Dihydroxy-3-phosphonooxy-cyclohex-1-enecarboxylic acid anion (CHEBI:241925) has functional parent shikimic acid (CHEBI:16119) |
| 3-dehydroshikimic acid (CHEBI:30918) has functional parent shikimic acid (CHEBI:16119) |
| 3-phosphoshikimic acid (CHEBI:17052) has functional parent shikimic acid (CHEBI:16119) |
| 4-coumaroylshikimic acid (CHEBI:16428) has functional parent shikimic acid (CHEBI:16119) |
| 5-[(E)-caffeoyl]shikimic acid (CHEBI:2106) has functional parent shikimic acid (CHEBI:16119) |
| 5-O-(1-carboxyvinyl)-3-phosphoshikimic acid (CHEBI:16257) has functional parent shikimic acid (CHEBI:16119) |
| 5-amino-5-deoxy-3-dehydroshikimic acid (CHEBI:29514) has functional parent shikimic acid (CHEBI:16119) |
| shikimate (CHEBI:36208) is conjugate base of shikimic acid (CHEBI:16119) |
| IUPAC Name |
|---|
| (3R,4S,5R)-3,4,5-trihydroxycyclohex-1-ene-1-carboxylic acid |
| Synonyms | Source |
|---|---|
| 3,4,5-Trihydroxy-1-cyclohexenecarboxylic acid | KEGG COMPOUND |
| [3R-(3α,4α,5β)]-3,4,5-trihydroxy-1-cyclohexene-1-carboxylic acid | NIST Chemistry WebBook |
| 3α,4α,5β-trihydroxy-1-cyclohexene-1-carboxylic acid | ChemIDplus |
| L-shikimic acid | ChEBI |
| Shikimate | KEGG COMPOUND |
| Shikimic acid | KEGG COMPOUND |
| Manual Xrefs | Databases |
|---|---|
| C00001203 | KNApSAcK |
| C00493 | KEGG COMPOUND |
| HMDB0003070 | HMDB |
| Shikimic_acid | Wikipedia |
| SKM | PDBeChem |
| Citations |
|---|