EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:16257 - 5-O-(1-carboxyvinyl)-3-phosphoshikimic acid
| Formula | C10H13O10P |
| Net Charge | 0 |
| Average Mass | 324.178 |
| Monoisotopic Mass | 324.02463 |
| SMILES | C=C(O[C@@H]1CC(C(=O)O)=C[C@@H](OP(=O)(O)O)[C@H]1O)C(=O)O |
| InChI | InChI=1S/C10H13O10P/c1-4(9(12)13)19-6-2-5(10(14)15)3-7(8(6)11)20-21(16,17)18/h3,6-8,11H,1-2H2,(H,12,13)(H,14,15)(H2,16,17,18)/t6-,7-,8+/m1/s1 |
| InChIKey | QUTYKIXIUDQOLK-PRJMDXOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Escherichia coli (ncbitaxon:562) | - | PubMed (21988831) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | Escherichia coli metabolite Any bacterial metabolite produced during a metabolic reaction in Escherichia coli. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 5-O-(1-carboxyvinyl)-3-phosphoshikimic acid (CHEBI:16257) has functional parent shikimic acid (CHEBI:16119) |
| 5-O-(1-carboxyvinyl)-3-phosphoshikimic acid (CHEBI:16257) has role Escherichia coli metabolite (CHEBI:76971) |
| 5-O-(1-carboxyvinyl)-3-phosphoshikimic acid (CHEBI:16257) is a phosphoshikimic acid (CHEBI:37412) |
| 5-O-(1-carboxyvinyl)-3-phosphoshikimic acid (CHEBI:16257) is a polyunsaturated dicarboxylic acid (CHEBI:134531) |
| 5-O-(1-carboxyvinyl)-3-phosphoshikimic acid (CHEBI:16257) is conjugate acid of 5-O-(1-carboxylatovinyl)-3-phosphonatoshikimate (CHEBI:57701) |
| Incoming Relation(s) |
| 5-O-(1-carboxylatovinyl)-3-phosphonatoshikimate (CHEBI:57701) is conjugate base of 5-O-(1-carboxyvinyl)-3-phosphoshikimic acid (CHEBI:16257) |
| IUPAC Name |
|---|
| (3R,4S,5R)-5-(1-carboxyethenyloxy)-4-hydroxy-3-(phosphonooxy)cyclohex-1-ene-1-carboxylic acid |
| Synonyms | Source |
|---|---|
| 5-O-(1-carboxyvinyl)-3-phosphoshikimate | ChEBI |
| 5-O-(1-Carboxyvinyl)-3-phosphoshikimate | KEGG COMPOUND |
| O5-(1-carboxyvinyl)-3-phosphoshikimate | ChEBI |
| O5-(1-Carboxyvinyl)-3-phosphoshikimate | KEGG COMPOUND |
| Citations |
|---|