EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C7H11O8P |
| Net Charge | 0 |
| Average Mass | 254.131 |
| Monoisotopic Mass | 254.01915 |
| SMILES | O=C(O)C1=C[C@@H](OP(=O)(O)O)[C@@H](O)[C@H](O)C1 |
| InChI | InChI=1S/C7H11O8P/c8-4-1-3(7(10)11)2-5(6(4)9)15-16(12,13)14/h2,4-6,8-9H,1H2,(H,10,11)(H2,12,13,14)/t4-,5-,6+/m1/s1 |
| InChIKey | QYOJSKGCWNAKGW-PBXRRBTRSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Escherichia coli (ncbitaxon:562) | - | PubMed (21988831) |
| Roles Classification |
|---|
| Biological Role: | Escherichia coli metabolite Any bacterial metabolite produced during a metabolic reaction in Escherichia coli. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 3-phosphoshikimic acid (CHEBI:17052) has functional parent shikimic acid (CHEBI:16119) |
| 3-phosphoshikimic acid (CHEBI:17052) has role Escherichia coli metabolite (CHEBI:76971) |
| 3-phosphoshikimic acid (CHEBI:17052) is a phosphoshikimic acid (CHEBI:37412) |
| 3-phosphoshikimic acid (CHEBI:17052) is conjugate acid of 3-phosphonatoshikimate(3−) (CHEBI:145989) |
| Incoming Relation(s) |
| 3-phosphonatoshikimate(3−) (CHEBI:145989) is conjugate base of 3-phosphoshikimic acid (CHEBI:17052) |
| IUPAC Name |
|---|
| rel-(3R,4S,5R)-4,5-dihydroxy-3-(phosphonooxy)cyclohex-1-ene-1-carboxylic acid |
| Synonyms | Source |
|---|---|
| Shikimate 3-phosphate | KEGG COMPOUND |
| Shikimate 5-phosphate | KEGG COMPOUND |