EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C16H16O8 |
| Net Charge | 0 |
| Average Mass | 336.296 |
| Monoisotopic Mass | 336.08452 |
| SMILES | O=C(/C=C/c1ccc(O)c(O)c1)O[C@@H]1CC(C(=O)O)=C[C@@H](O)[C@H]1O |
| InChI | InChI=1S/C16H16O8/c17-10-3-1-8(5-11(10)18)2-4-14(20)24-13-7-9(16(22)23)6-12(19)15(13)21/h1-6,12-13,15,17-19,21H,7H2,(H,22,23)/b4-2+/t12-,13-,15-/m1/s1 |
| InChIKey | QMPHZIPNNJOWQI-GDDAOPKQSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Arabidopsis thaliana (ncbitaxon:3702) | - | PubMed (23950498) | |
| Urceola huaitingii (ncbitaxon:1398147) | - | PubMed (19579182) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 5-[(E)-caffeoyl]shikimic acid (CHEBI:2106) has functional parent trans-caffeic acid (CHEBI:16433) |
| 5-[(E)-caffeoyl]shikimic acid (CHEBI:2106) has functional parent shikimic acid (CHEBI:16119) |
| 5-[(E)-caffeoyl]shikimic acid (CHEBI:2106) has role plant metabolite (CHEBI:76924) |
| 5-[(E)-caffeoyl]shikimic acid (CHEBI:2106) is a carboxylic ester (CHEBI:33308) |
| 5-[(E)-caffeoyl]shikimic acid (CHEBI:2106) is a catechols (CHEBI:33566) |
| 5-[(E)-caffeoyl]shikimic acid (CHEBI:2106) is a cyclohexenecarboxylic acid (CHEBI:23483) |
| 5-[(E)-caffeoyl]shikimic acid (CHEBI:2106) is a α,β-unsaturated monocarboxylic acid (CHEBI:79020) |
| 5-[(E)-caffeoyl]shikimic acid (CHEBI:2106) is conjugate acid of 5-[(E)-caffeoyl]shikimate (CHEBI:91005) |
| Incoming Relation(s) |
| 5-[(E)-caffeoyl]shikimate (CHEBI:91005) is conjugate base of 5-[(E)-caffeoyl]shikimic acid (CHEBI:2106) |
| IUPAC Names |
|---|
| (3R,4R,5R)-5-{[(2E)-3-(3,4-dihydroxyphenyl)prop-2-enoyl]oxy}-3,4-dihydroxycyclohex-1-ene-1-carboxylic acid |
| 5-(trans-caffeoyl)shikimic acid |
| Synonym | Source |
|---|---|
| 5-caffeoylshikimic acid | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| C00002720 | KNApSAcK |
| C10434 | KEGG COMPOUND |
| CAFFEOYLSHIKIMATE | MetaCyc |
| Registry Numbers | Sources |
|---|---|
| Reaxys:5610056 | Reaxys |
| CAS:73263-62-4 | KEGG COMPOUND |
| CAS:73263-62-4 | ChemIDplus |
| Citations |
|---|