EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C30H18O10 |
| Net Charge | 0 |
| Average Mass | 538.464 |
| Monoisotopic Mass | 538.09000 |
| SMILES | O=c1cc(-c2ccc(O)c(-c3c(O)cc(O)c4c(=O)cc(-c5ccc(O)cc5)oc34)c2)oc2cc(O)cc(O)c12 |
| InChI | InChI=1S/C30H18O10/c31-15-4-1-13(2-5-15)24-12-23(38)29-21(36)10-20(35)27(30(29)40-24)17-7-14(3-6-18(17)33)25-11-22(37)28-19(34)8-16(32)9-26(28)39-25/h1-12,31-36H |
| InChIKey | YUSWMAULDXZHPY-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Biophytum sensitivum (IPNI:371965-1) | - | PubMed (18298378) | |
| Cupressus cashmeriana (ncbitaxon:187464) | - | DOI (10.1021/np50051a032) | |
| Cupressus sempervirens (ncbitaxon:13469) | - | DOI (10.1021/np50051a032) | |
| Cycas rumphii (ncbitaxon:58031) | - | PubMed (15130600) | |
| Ginkgo biloba (ncbitaxon:3311) | - | PubMed (3212094) | |
| Hypericum perforatum (ncbitaxon:65561) | - | PubMed (16084098) | |
| Juniperus occidentalis (ncbitaxon:114265) | - | PubMed (12372862) | |
| Lanaria lanata (ncbitaxon:59087) | - | DOI (10.1021/np50075a007) | |
| Selaginella braunii (ITIS:17074) | - | PubMed (11256492) | |
| Selaginella davidii (ncbitaxon:417315) | - | PubMed (11256492) | |
| Selaginella doederleinii (ncbitaxon:186426) | - | PubMed (11256492) | |
| Selaginella pulvinata (ncbitaxon:672198) | - | PubMed (11256492) | |
| Selaginella sinensis (ncbitaxon:137174) | - | PubMed (11256492) | |
| Selaginella stauntoniana (ncbitaxon:137175) | - | PubMed (11256492) | |
| Selaginella tamariscina (ncbitaxon:137178) | - | PubMed (11256492) | |
| Selaginella uncinata (ncbitaxon:307165) | - | PubMed (11256492) | |
| Selanginella moellendorfii (ncbitaxon:88036) | - | PubMed (11256492) | |
| Taxodium mucronatum (ncbitaxon:99812) | - | PubMed (16084098) | |
| Taxus baccata (ncbitaxon:25629) | - | Article (INDIAN J CHEM,35B,283) | |
| Thuja orientalis (ncbitaxon:58046) | - | PubMed (19280159) |
| Roles Classification |
|---|
| Biological Roles: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. P450 inhibitor An enzyme inhibitor that interferes with the activity of cytochrome P450 involved in catalysis of organic substances. antiviral agent A substance that destroys or inhibits replication of viruses. cathepsin B inhibitor A cysteine protease inhibitor which inhibits cathepsin B (EC 3.4.22.1). |
| Application: | angiogenesis inhibitor An agent and endogenous substances that antagonize or inhibit the development of new blood vessels. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| amentoflavone (CHEBI:2631) has role angiogenesis inhibitor (CHEBI:48422) |
| amentoflavone (CHEBI:2631) has role antiviral agent (CHEBI:22587) |
| amentoflavone (CHEBI:2631) has role cathepsin B inhibitor (CHEBI:64932) |
| amentoflavone (CHEBI:2631) has role P450 inhibitor (CHEBI:50183) |
| amentoflavone (CHEBI:2631) has role plant metabolite (CHEBI:76924) |
| amentoflavone (CHEBI:2631) is a biflavonoid (CHEBI:50128) |
| amentoflavone (CHEBI:2631) is a hydroxyflavone (CHEBI:24698) |
| amentoflavone (CHEBI:2631) is a ring assembly (CHEBI:36820) |
| Incoming Relation(s) |
| 2,3-dihydro-4',4'''-di-O-methylamentoflavone (CHEBI:65770) has functional parent amentoflavone (CHEBI:2631) |
| ginkgetin (CHEBI:5353) has functional parent amentoflavone (CHEBI:2631) |
| sciadopitysin (CHEBI:9050) has functional parent amentoflavone (CHEBI:2631) |
| IUPAC Name |
|---|
| 8-[5-(5,7-dihydroxy-4-oxo-4H-chromen-2-yl)-2-hydroxyphenyl]-5,7-dihydroxy-2-(4-hydroxyphenyl)-4H-chromen-4-one |
| Synonyms | Source |
|---|---|
| 3',8''-Biapigenin | KEGG COMPOUND |
| 8-(5-(5,7-dihydroxy-4-oxo-4H-1-benzopyran-2-yl)-2-hydroxyphenyl)-5,7-dihydroxy-2-(4-hydroxyphenyl)-4H-1-benzopyran-4-one | ChEBI |
| Didemethyl-ginkgetin | HMDB |
| Manual Xrefs | Databases |
|---|---|
| Amentoflavone | Wikipedia |
| C00001015 | KNApSAcK |
| C10018 | KEGG COMPOUND |
| HMDB0030832 | HMDB |
| LMPK12040009 | LIPID MAPS |
| Registry Numbers | Sources |
|---|---|
| Reaxys:380244 | Reaxys |
| CAS:1617-53-4 | ChemIDplus |
| CAS:1617-53-4 | KEGG COMPOUND |
| Citations |
|---|