EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C30H18O10 |
| Net Charge | 0 |
| Average Mass | 538.464 |
| Monoisotopic Mass | 538.09000 |
| SMILES | O=c1cc(-c2ccc(O)c(-c3c(O)cc(O)c4c(=O)cc(-c5ccc(O)cc5)oc34)c2)oc2cc(O)cc(O)c12 |
| InChI | InChI=1S/C30H18O10/c31-15-4-1-13(2-5-15)24-12-23(38)29-21(36)10-20(35)27(30(29)40-24)17-7-14(3-6-18(17)33)25-11-22(37)28-19(34)8-16(32)9-26(28)39-25/h1-12,31-36H |
| InChIKey | YUSWMAULDXZHPY-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Taxus baccata (ncbitaxon:25629) | - | Article (INDIAN J CHEM,35B,283) | |
| Lanaria lanata (ncbitaxon:59087) | - | DOI (10.1021/np50075a007) | |
| Juniperus occidentalis (ncbitaxon:114265) | - | PubMed (12372862) | |
| Cupressus sempervirens (ncbitaxon:13469) | - | DOI (10.1021/np50051a032) | |
| Selaginella pulvinata (ncbitaxon:672198) | - | PubMed (11256492) | |
| Selanginella moellendorfii (ncbitaxon:88036) | - | PubMed (11256492) | |
| Thuja orientalis (ncbitaxon:58046) | - | PubMed (19280159) | |
| Biophytum sensitivum (IPNI:371965-1) | - | PubMed (18298378) | |
| Selaginella braunii (ITIS:17074) | - | PubMed (11256492) | |
| Ginkgo biloba (ncbitaxon:3311) | - | PubMed (3212094) | |
| Selaginella stauntoniana (ncbitaxon:137175) | - | PubMed (11256492) | |
| Selaginella tamariscina (ncbitaxon:137178) | - | PubMed (11256492) | |
| Selaginella davidii (ncbitaxon:417315) | - | PubMed (11256492) | |
| Cupressus cashmeriana (ncbitaxon:187464) | - | DOI (10.1021/np50051a032) | |
| Hypericum perforatum (ncbitaxon:65561) | - | PubMed (16084098) | |
| Cycas rumphii (ncbitaxon:58031) | - | PubMed (15130600) | |
| Selaginella uncinata (ncbitaxon:307165) | - | PubMed (11256492) | |
| Taxodium mucronatum (ncbitaxon:99812) | - | PubMed (16084098) | |
| Selaginella sinensis (ncbitaxon:137174) | - | PubMed (11256492) | |
| Selaginella doederleinii (ncbitaxon:186426) | - | PubMed (11256492) |
| Roles Classification |
|---|
| Biological Roles: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. cathepsin B inhibitor A cysteine protease inhibitor which inhibits cathepsin B (EC 3.4.22.1). antiviral agent A substance that destroys or inhibits replication of viruses. P450 inhibitor An enzyme inhibitor that interferes with the activity of cytochrome P450 involved in catalysis of organic substances. |
| Application: | angiogenesis inhibitor An agent and endogenous substances that antagonize or inhibit the development of new blood vessels. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| amentoflavone (CHEBI:2631) has role angiogenesis inhibitor (CHEBI:48422) |
| amentoflavone (CHEBI:2631) has role antiviral agent (CHEBI:22587) |
| amentoflavone (CHEBI:2631) has role cathepsin B inhibitor (CHEBI:64932) |
| amentoflavone (CHEBI:2631) has role P450 inhibitor (CHEBI:50183) |
| amentoflavone (CHEBI:2631) has role plant metabolite (CHEBI:76924) |
| amentoflavone (CHEBI:2631) is a biflavonoid (CHEBI:50128) |
| amentoflavone (CHEBI:2631) is a hydroxyflavone (CHEBI:24698) |
| amentoflavone (CHEBI:2631) is a ring assembly (CHEBI:36820) |
| Incoming Relation(s) |
| 2,3-dihydro-4',4'''-di-O-methylamentoflavone (CHEBI:65770) has functional parent amentoflavone (CHEBI:2631) |
| ginkgetin (CHEBI:5353) has functional parent amentoflavone (CHEBI:2631) |
| sciadopitysin (CHEBI:9050) has functional parent amentoflavone (CHEBI:2631) |
| IUPAC Name |
|---|
| 8-[5-(5,7-dihydroxy-4-oxo-4H-chromen-2-yl)-2-hydroxyphenyl]-5,7-dihydroxy-2-(4-hydroxyphenyl)-4H-chromen-4-one |
| Synonyms | Source |
|---|---|
| 3',8''-Biapigenin | KEGG COMPOUND |
| 8-(5-(5,7-dihydroxy-4-oxo-4H-1-benzopyran-2-yl)-2-hydroxyphenyl)-5,7-dihydroxy-2-(4-hydroxyphenyl)-4H-1-benzopyran-4-one | ChEBI |
| Didemethyl-ginkgetin | HMDB |
| Manual Xrefs | Databases |
|---|---|
| C10018 | KEGG COMPOUND |
| LMPK12040009 | LIPID MAPS |
| HMDB0030832 | HMDB |
| Amentoflavone | Wikipedia |
| C00001015 | KNApSAcK |
| Registry Numbers | Sources |
|---|---|
| Reaxys:380244 | Reaxys |
| CAS:1617-53-4 | KEGG COMPOUND |
| CAS:1617-53-4 | ChemIDplus |
| Citations |
|---|