EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C32H22O10 |
| Net Charge | 0 |
| Average Mass | 566.518 |
| Monoisotopic Mass | 566.12130 |
| SMILES | COc1cc(O)c2c(=O)cc(-c3ccc(OC)c(-c4c(O)cc(O)c5c(=O)cc(-c6ccc(O)cc6)oc45)c3)oc2c1 |
| InChI | InChI=1S/C32H22O10/c1-39-18-10-20(34)30-23(37)13-27(41-28(30)11-18)16-5-8-25(40-2)19(9-16)29-21(35)12-22(36)31-24(38)14-26(42-32(29)31)15-3-6-17(33)7-4-15/h3-14,33-36H,1-2H3 |
| InChIKey | AIFCFBUSLAEIBR-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Cephalotaxus harringtonia (ncbitaxon:58029) | - | DOI (10.1016/0031-9422(73)80020-2) | |
| Cephalotaxus harringtonia var. drupacea (ncbitaxon:224739) | |||
| leaf (BTO:0000713) | PubMed (1329635) | ||
| twig (BTO:0001411) | PubMed (1329635) | ||
| Dacrydium (ncbitaxon:56889) | |||
| leaf (BTO:0000713) | PubMed (9134745) | ||
| branch (BTO:0000148) | PubMed (9134745) | Previous component: branchlet; | |
| Dioon (ncbitaxon:58032) | - | DOI (10.1016/0031-9422(73)80020-2) | |
| Ginkgo biloba (ncbitaxon:3311) | leaf (BTO:0000713) | PubMed (16327145) | |
| Selanginella moellendorfii (ncbitaxon:88036) | - | PubMed (9134745) |
| Roles Classification |
|---|
| Biological Roles: | anti-HSV-1 agent An anti-HSV agent agent that destroys or inhibits the replication of herpes simplex virus-1. metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. cyclooxygenase 2 inhibitor A cyclooxygenase inhibitor that interferes with the action of cyclooxygenase 2. EC 1.13.11.34 (arachidonate 5-lipoxygenase) inhibitor A lipoxygenase inhibitor that interferes with the action of arachidonate 5-lipoxygenase (EC 1.13.11.34). |
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| ginkgetin (CHEBI:5353) has functional parent amentoflavone (CHEBI:2631) |
| ginkgetin (CHEBI:5353) has role anti-HSV-1 agent (CHEBI:64953) |
| ginkgetin (CHEBI:5353) has role antineoplastic agent (CHEBI:35610) |
| ginkgetin (CHEBI:5353) has role cyclooxygenase 2 inhibitor (CHEBI:50629) |
| ginkgetin (CHEBI:5353) has role EC 1.13.11.34 (arachidonate 5-lipoxygenase) inhibitor (CHEBI:64964) |
| ginkgetin (CHEBI:5353) has role metabolite (CHEBI:25212) |
| ginkgetin (CHEBI:5353) is a biflavonoid (CHEBI:50128) |
| ginkgetin (CHEBI:5353) is a hydroxyflavone (CHEBI:24698) |
| ginkgetin (CHEBI:5353) is a methoxyflavone (CHEBI:25241) |
| ginkgetin (CHEBI:5353) is a ring assembly (CHEBI:36820) |
| IUPAC Name |
|---|
| 5,7-dihydroxy-8-[5-(5-hydroxy-7-methoxy-4-oxo-4H-chromen-2-yl)-2-methoxyphenyl]-2-(4-hydroxyphenyl)-4H-chromen-4-one |
| Synonyms | Source |
|---|---|
| 4''',5,5'',7''-tetrahydroxy-4',7-dimethoxy-(3'→8'')-biflavone | ChEBI |
| 5,7-dihydroxy-8-(5-(5-hydroxy-7-methoxy-4-oxo-4H-1-benzopyran-2-yl)-2-methoxyphenyl)-2-(4-hydroxyphenyl)-4H-1-benzopyran-4-one | ChEBI |
| amentoflavone 7,4'-dimethyl ether | ChEBI |
| Amentoflavone 7,4'-dimethyl ether | KEGG COMPOUND |
| Ginkgetin | KEGG COMPOUND |
| Manual Xrefs | Databases |
|---|---|
| C00001044 | KNApSAcK |
| C10048 | KEGG COMPOUND |
| LMPK12040003 | LIPID MAPS |
| LSM-42758 | LINCS |
| Registry Numbers | Sources |
|---|---|
| Reaxys:381052 | Reaxys |
| CAS:481-46-9 | ChemIDplus |
| CAS:481-46-9 | KEGG COMPOUND |
| Citations |
|---|