EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C32H24O10 |
| Net Charge | 0 |
| Average Mass | 568.534 |
| Monoisotopic Mass | 568.13695 |
| SMILES | COc1ccc(-c2cc(=O)c3c(O)cc(O)c(-c4cc([C@@H]5CC(=O)c6c(O)cc(O)cc6O5)ccc4OC)c3o2)cc1 |
| InChI | InChI=1S/C32H24O10/c1-39-18-6-3-15(4-7-18)26-14-24(38)31-22(36)12-21(35)29(32(31)42-26)19-9-16(5-8-25(19)40-2)27-13-23(37)30-20(34)10-17(33)11-28(30)41-27/h3-12,14,27,33-36H,13H2,1-2H3/t27-/m0/s1 |
| InChIKey | DAZOCAXXKGNMBF-MHZLTWQESA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Podocarpus macrophyllus var. macrophyllus (ncbitaxon:1030199) | leaf (BTO:0000713) | PubMed (17473463) | Fresh leaf |
| Roles Classification |
|---|
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 2,3-dihydro-4',4'''-di-O-methylamentoflavone (CHEBI:65770) has functional parent amentoflavone (CHEBI:2631) |
| 2,3-dihydro-4',4'''-di-O-methylamentoflavone (CHEBI:65770) has role plant metabolite (CHEBI:76924) |
| 2,3-dihydro-4',4'''-di-O-methylamentoflavone (CHEBI:65770) is a biflavonoid (CHEBI:50128) |
| 2,3-dihydro-4',4'''-di-O-methylamentoflavone (CHEBI:65770) is a hydroxyflavanone (CHEBI:24697) |
| 2,3-dihydro-4',4'''-di-O-methylamentoflavone (CHEBI:65770) is a hydroxyflavone (CHEBI:24698) |
| 2,3-dihydro-4',4'''-di-O-methylamentoflavone (CHEBI:65770) is a methoxyflavanone (CHEBI:25240) |
| 2,3-dihydro-4',4'''-di-O-methylamentoflavone (CHEBI:65770) is a methoxyflavone (CHEBI:25241) |
| IUPAC Name |
|---|
| 8-{5-[(2S)-5,7-dihydroxy-4-oxo-3,4-dihydro-2H-1-benzopyran-2-yl]-2-methoxyphenyl}-5,7-dihydroxy-2-(4-methoxyphenyl)-4H-1-benzopyran-4-one |
| Registry Numbers | Sources |
|---|---|
| Reaxys:11101569 | Reaxys |
| Citations |
|---|