EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:9050 - sciadopitysin
| Formula | C33H24O10 |
| Net Charge | 0 |
| Average Mass | 580.545 |
| Monoisotopic Mass | 580.13695 |
| SMILES | COc1ccc(-c2cc(=O)c3c(O)cc(O)c(-c4cc(-c5cc(=O)c6c(O)cc(OC)cc6o5)ccc4OC)c3o2)cc1 |
| InChI | InChI=1S/C33H24O10/c1-39-18-7-4-16(5-8-18)27-15-25(38)32-23(36)13-22(35)30(33(32)43-27)20-10-17(6-9-26(20)41-3)28-14-24(37)31-21(34)11-19(40-2)12-29(31)42-28/h4-15,34-36H,1-3H3 |
| InChIKey | YCXRBCHEOFVYEN-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Applications: | bone density conservation agent An agent that inhibits bone resorption and/or favor bone mineralization and bone regeneration. Used to heal bone fractures and to treat bone diseases such as osteopenia and osteoporosis. platelet aggregation inhibitor A drug or agent which antagonizes or impairs any mechanism leading to blood platelet aggregation, whether during the phases of activation and shape change or following the dense-granule release reaction and stimulation of the prostaglandin-thromboxane system. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| sciadopitysin (CHEBI:9050) has functional parent amentoflavone (CHEBI:2631) |
| sciadopitysin (CHEBI:9050) has role bone density conservation agent (CHEBI:50646) |
| sciadopitysin (CHEBI:9050) has role platelet aggregation inhibitor (CHEBI:50427) |
| sciadopitysin (CHEBI:9050) is a biflavonoid (CHEBI:50128) |
| sciadopitysin (CHEBI:9050) is a hydroxyflavone (CHEBI:24698) |
| sciadopitysin (CHEBI:9050) is a methoxyflavone (CHEBI:25241) |
| sciadopitysin (CHEBI:9050) is a ring assembly (CHEBI:36820) |
| IUPAC Name |
|---|
| 5,7-dihydroxy-8-[5-(5-hydroxy-7-methoxy-4-oxo-4H-chromen-2-yl)-2-methoxyphenyl]-2-(4-methoxyphenyl)-4H-chromen-4-one |
| Synonyms | Source |
|---|---|
| Sciadopitysin | KEGG COMPOUND |
| 5,7-dihydroxy-8-(5-(5-hydroxy-7-methoxy-4-oxo-4H-1- benzopyran-2-yl)-2-methoxyphenyl)-2-(4-methoxyphenyl)-4- benzopyrone | ChEBI |
| Amentoflavone-7,4',4'''-trimethyl ether | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| C10182 | KEGG COMPOUND |
| LMPK12040006 | LIPID MAPS |
| NZ563818 | Patent |
| C00001098 | KNApSAcK |
| Registry Numbers | Sources |
|---|---|
| Reaxys:381493 | Reaxys |
| CAS:521-34-6 | KEGG COMPOUND |
| CAS:521-34-6 | ChemIDplus |
| Citations |
|---|