EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
We are looking for a new Chemistry curator to join the ChEBI team. Find out more about it here.
CHEBI:33508 - glyceric acid
| Formula | C3H6O4 |
| Net Charge | 0 |
| Average Mass | 106.077 |
| Monoisotopic Mass | 106.02661 |
| SMILES | O=C(O)C(O)CO |
| InChI | InChI=1S/C3H6O4/c4-1-2(5)3(6)7/h2,4-5H,1H2,(H,6,7) |
| InChIKey | RBNPOMFGQQGHHO-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | fundamental metabolite Any metabolite produced by all living cells. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| glyceric acid (CHEBI:33508) has functional parent propionic acid (CHEBI:30768) |
| glyceric acid (CHEBI:33508) has role fundamental metabolite (CHEBI:78675) |
| glyceric acid (CHEBI:33508) is a trionic acid (CHEBI:33754) |
| glyceric acid (CHEBI:33508) is conjugate acid of glycerate (CHEBI:33871) |
| Incoming Relation(s) |
| N-acetyl-S-glyceroyl-L-cysteine (CHEBI:131338) has functional parent glyceric acid (CHEBI:33508) |
| 2-phosphoglyceric acid (CHEBI:24344) has functional parent glyceric acid (CHEBI:33508) |
| 2,3-bisphosphoglyceric acid (CHEBI:28907) has functional parent glyceric acid (CHEBI:33508) |
| 3-ADP-2-phosphoglyceric acid (CHEBI:18117) has functional parent glyceric acid (CHEBI:33508) |
| 3-phosphoglyceric acid (CHEBI:17050) has functional parent glyceric acid (CHEBI:33508) |
| D-glyceric acid (CHEBI:32398) is a glyceric acid (CHEBI:33508) |
| L-glyceric acid (CHEBI:74324) is a glyceric acid (CHEBI:33508) |
| glycerate (CHEBI:33871) is conjugate base of glyceric acid (CHEBI:33508) |
| glyceroyl group (CHEBI:30750) is substituent group from glyceric acid (CHEBI:33508) |
| IUPAC Name |
|---|
| 2,3-dihydroxypropanoic acid |
| Synonyms | Source |
|---|---|
| 2,3-dihydroxypropionic acid | ChEBI |
| glyceric acid | ChemIDplus |
| Gro | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| Glyceric_acid | Wikipedia |
| Registry Numbers | Sources |
|---|---|
| Gmelin:164608 | Gmelin |
| Beilstein:1721417 | Beilstein |
| Reaxys:1721417 | Reaxys |
| CAS:473-81-4 | ChemIDplus |
| Citations |
|---|