EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C13H20N5O16P3 |
| Net Charge | 0 |
| Average Mass | 595.244 |
| Monoisotopic Mass | 595.01179 |
| SMILES | Nc1ncnc2c1ncn2[C@@H]1O[C@H](COP(=O)(O)OP(=O)(O)OCC(OP(=O)(O)O)C(=O)O)[C@@H](O)[C@H]1O |
| InChI | InChI=1S/C13H20N5O16P3/c14-10-7-11(16-3-15-10)18(4-17-7)12-9(20)8(19)5(32-12)1-30-36(26,27)34-37(28,29)31-2-6(13(21)22)33-35(23,24)25/h3-6,8-9,12,19-20H,1-2H2,(H,21,22)(H,26,27)(H,28,29)(H2,14,15,16)(H2,23,24,25)/t5-,6?,8-,9-,12-/m1/s1 |
| InChIKey | FNEVPPRBJBZTAF-MDSCUQPFSA-N |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 3-ADP-2-phosphoglyceric acid (CHEBI:18117) has functional parent glyceric acid (CHEBI:33508) |
| 3-ADP-2-phosphoglyceric acid (CHEBI:18117) is a 3-ADP-glyceric acid (CHEBI:16515) |
| 3-ADP-2-phosphoglyceric acid (CHEBI:18117) is a tetronic acid derivative (CHEBI:63455) |
| 3-ADP-2-phosphoglyceric acid (CHEBI:18117) is conjugate acid of 3-ADP-2-phosphoglycerate(5−) (CHEBI:58381) |
| Incoming Relation(s) |
| 3-ADP-2-phosphoglycerate(5−) (CHEBI:58381) is conjugate base of 3-ADP-2-phosphoglyceric acid (CHEBI:18117) |
| IUPAC Name |
|---|
| 3-{[(adenosin-5'-yl)(hydroxy)phosphoryloxy](hydroxy)phosphoryloxy}-2-(phosphonooxy)propanoic acid |
| Synonym | Source |
|---|---|
| 3-(ADP)-2-phosphoglycerate | KEGG COMPOUND |