EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C3H5O4 |
| Net Charge | -1 |
| Average Mass | 105.069 |
| Monoisotopic Mass | 105.01933 |
| SMILES | O=C([O-])C(O)CO |
| InChI | InChI=1S/C3H6O4/c4-1-2(5)3(6)7/h2,4-5H,1H2,(H,6,7)/p-1 |
| InChIKey | RBNPOMFGQQGHHO-UHFFFAOYSA-M |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Homo sapiens (ncbitaxon:9606) | - | DOI (10.1038/nbt.2488) |
| Roles Classification |
|---|
| Biological Roles: | fundamental metabolite Any metabolite produced by all living cells. human metabolite Any mammalian metabolite produced during a metabolic reaction in humans (Homo sapiens). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| glycerate (CHEBI:33871) has functional parent propionate (CHEBI:17272) |
| glycerate (CHEBI:33871) has role fundamental metabolite (CHEBI:78675) |
| glycerate (CHEBI:33871) has role human metabolite (CHEBI:77746) |
| glycerate (CHEBI:33871) is a glycerates (CHEBI:24347) |
| glycerate (CHEBI:33871) is a hydroxy monocarboxylic acid anion (CHEBI:36059) |
| glycerate (CHEBI:33871) is conjugate base of glyceric acid (CHEBI:33508) |
| Incoming Relation(s) |
| D-glycerate (CHEBI:16659) is a glycerate (CHEBI:33871) |
| glyceric acid (CHEBI:33508) is conjugate acid of glycerate (CHEBI:33871) |
| UniProt Name | Source |
|---|---|
| glycerate | UniProt |
| Registry Numbers | Sources |
|---|---|
| Reaxys:3602204 | Reaxys |