EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C5H9NO3 |
| Net Charge | 0 |
| Average Mass | 131.131 |
| Monoisotopic Mass | 131.05824 |
| SMILES | NC(=O)CCCC(=O)O |
| InChI | InChI=1S/C5H9NO3/c6-4(7)2-1-3-5(8)9/h1-3H2,(H2,6,7)(H,8,9) |
| InChIKey | GTFMAONWNTUZEW-UHFFFAOYSA-N |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| glutaramic acid (CHEBI:24326) has functional parent glutaric acid (CHEBI:17859) |
| glutaramic acid (CHEBI:24326) is a dicarboxylic acid monoamide (CHEBI:35735) |
| glutaramic acid (CHEBI:24326) is conjugate acid of glutaramate (CHEBI:35908) |
| Incoming Relation(s) |
| 2-hydroxyglutaramic acid (CHEBI:149653) has functional parent glutaramic acid (CHEBI:24326) |
| 2-oxoglutaramic acid (CHEBI:30882) has functional parent glutaramic acid (CHEBI:24326) |
| 4-oxoglutaramic acid (CHEBI:30883) has functional parent glutaramic acid (CHEBI:24326) |
| glutaramates (CHEBI:24325) is a glutaramic acid (CHEBI:24326) |
| glutaramate (CHEBI:35908) is conjugate base of glutaramic acid (CHEBI:24326) |
| IUPAC Name |
|---|
| 5-amino-5-oxopentanoic acid |
| Synonyms | Source |
|---|---|
| 4-carbamoylbutanoic acid | IUPAC |
| glutaramic acid | ChemIDplus |
| 4-(aminocarbonyl)butanoic acid | IUPAC |
| 4-carboxybutyramide | ChEBI |
| glutaric acid monoamide | ChEBI |
| 4-carbamoylbutyric acid | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Reaxys:1759038 | Reaxys |
| CAS:25335-74-4 | ChemIDplus |