EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C5H7NO4 |
| Net Charge | 0 |
| Average Mass | 145.114 |
| Monoisotopic Mass | 145.03751 |
| SMILES | NC(=O)CCC(=O)C(=O)O |
| InChI | InChI=1S/C5H7NO4/c6-4(8)2-1-3(7)5(9)10/h1-2H2,(H2,6,8)(H,9,10) |
| InChIKey | COJBGNAUUSNXHX-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 2-oxoglutaramic acid (CHEBI:30882) has functional parent glutaramic acid (CHEBI:24326) |
| 2-oxoglutaramic acid (CHEBI:30882) is a 2-oxo monocarboxylic acid (CHEBI:35910) |
| 2-oxoglutaramic acid (CHEBI:30882) is conjugate acid of 2-oxoglutaramate (CHEBI:16769) |
| Incoming Relation(s) |
| N-methyl-2-oxoglutaramic acid (CHEBI:37041) has functional parent 2-oxoglutaramic acid (CHEBI:30882) |
| 2-oxoglutaramate (CHEBI:16769) is conjugate base of 2-oxoglutaramic acid (CHEBI:30882) |
| IUPAC Name |
|---|
| 5-amino-2,5-dioxopentanoic acid |
| Synonyms | Source |
|---|---|
| 2-Ketoglutaramate | KEGG COMPOUND |
| 2-Oxoglutaramic acid | KEGG COMPOUND |
| alpha-Ketoglutaramate | KEGG COMPOUND |
| Manual Xrefs | Databases |
|---|---|
| C00940 | KEGG COMPOUND |
| Registry Numbers | Sources |
|---|---|
| Beilstein:2354281 | Beilstein |
| CAS:18465-19-5 | KEGG COMPOUND |