EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C5H7NO4 |
| Net Charge | 0 |
| Average Mass | 145.114 |
| Monoisotopic Mass | 145.03751 |
| SMILES | NC(=O)C(=O)CCC(=O)O |
| InChI | InChI=1S/C5H7NO4/c6-5(10)3(7)1-2-4(8)9/h1-2H2,(H2,6,10)(H,8,9) |
| InChIKey | UGKYJAWJZICPEX-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 4-oxoglutaramic acid (CHEBI:30883) has functional parent glutaramic acid (CHEBI:24326) |
| 4-oxoglutaramic acid (CHEBI:30883) is a 4-oxo monocarboxylic acid (CHEBI:35950) |
| 4-oxoglutaramic acid (CHEBI:30883) is conjugate acid of 4-oxoglutaramate (CHEBI:27467) |
| Incoming Relation(s) |
| 4-oxoglutaramate (CHEBI:27467) is conjugate base of 4-oxoglutaramic acid (CHEBI:30883) |
| IUPAC Name |
|---|
| 5-amino-4,5-dioxopentanoic acid |
| Manual Xrefs | Databases |
|---|---|
| C05572 | KEGG COMPOUND |
| Registry Numbers | Sources |
|---|---|
| Beilstein:1766302 | Beilstein |