EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C5H8NO3 |
| Net Charge | -1 |
| Average Mass | 130.123 |
| Monoisotopic Mass | 130.05097 |
| SMILES | NC(=O)CCCC(=O)[O-] |
| InChI | InChI=1S/C5H9NO3/c6-4(7)2-1-3-5(8)9/h1-3H2,(H2,6,7)(H,8,9)/p-1 |
| InChIKey | GTFMAONWNTUZEW-UHFFFAOYSA-M |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| glutaramate (CHEBI:35908) is a monocarboxylic acid anion (CHEBI:35757) |
| glutaramate (CHEBI:35908) is conjugate base of glutaramic acid (CHEBI:24326) |
| Incoming Relation(s) |
| 2-oxoglutaramate (CHEBI:16769) has functional parent glutaramate (CHEBI:35908) |
| 4-oxoglutaramate (CHEBI:27467) has functional parent glutaramate (CHEBI:35908) |
| glutaramic acid (CHEBI:24326) is conjugate acid of glutaramate (CHEBI:35908) |
| IUPAC Name |
|---|
| 5-amino-5-oxopentanoate |
| Synonyms | Source |
|---|---|
| 4-carbamoylbutanoate | IUPAC |
| 4-carbamoylbutyrate | ChEBI |