EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:23965 - estradiol
| Formula | C18H24O2 |
| Net Charge | 0 |
| Average Mass | 272.388 |
| Monoisotopic Mass | 272.17763 |
| SMILES | [H][C@@]12CCc3cc(O)ccc3[C@@]1([H])CC[C@]1(C)C(O)CC[C@@]21[H] |
| InChI | InChI=1S/C18H24O2/c1-18-9-8-14-13-5-3-12(19)10-11(13)2-4-15(14)16(18)6-7-17(18)20/h3,5,10,14-17,19-20H,2,4,6-9H2,1H3/t14-,15-,16+,17?,18+/m1/s1 |
| InChIKey | VOXZDWNPVJITMN-WKUFJEKOSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Roles: | estrogen A hormone that stimulates or controls the development and maintenance of female sex characteristics in mammals by binding to oestrogen receptors. The oestrogens are named for their importance in the oestrous cycle. The oestrogens that occur naturally in the body, notably estrone, estradiol, estriol, and estetrol are steroids. Other compounds with oestrogenic activity are produced by plants (phytoestrogens) and fungi (mycoestrogens); synthetic compounds with oestrogenic activity are known as xenoestrogens. human metabolite Any mammalian metabolite produced during a metabolic reaction in humans (Homo sapiens). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| estradiol (CHEBI:23965) has parent hydride estrane (CHEBI:23966) |
| estradiol (CHEBI:23965) has role estrogen (CHEBI:50114) |
| estradiol (CHEBI:23965) has role human metabolite (CHEBI:77746) |
| estradiol (CHEBI:23965) is a 17-hydroxy steroid (CHEBI:36838) |
| estradiol (CHEBI:23965) is a 3-hydroxy steroid (CHEBI:36834) |
| estradiol (CHEBI:23965) is a phenolic steroid (CHEBI:177917) |
| Incoming Relation(s) |
| 17α-ethynylestradiol (CHEBI:4903) has functional parent estradiol (CHEBI:23965) |
| ulipristal acetate (CHEBI:71025) has functional parent estradiol (CHEBI:23965) |
| 17α-estradiol (CHEBI:17160) is a estradiol (CHEBI:23965) |
| 17β-estradiol (CHEBI:16469) is a estradiol (CHEBI:23965) |
| IUPAC Name |
|---|
| estra-1,3,5(10)-triene-3,17-diol |
| Synonym | Source |
|---|---|
| oestradiol | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| Estradiol | Wikipedia |
| Citations |
|---|