EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C18H24O2 |
| Net Charge | 0 |
| Average Mass | 272.388 |
| Monoisotopic Mass | 272.17763 |
| SMILES | [H][C@@]12CCc3cc(O)ccc3[C@@]1([H])CC[C@]1(C)[C@H](O)CC[C@@]21[H] |
| InChI | InChI=1S/C18H24O2/c1-18-9-8-14-13-5-3-12(19)10-11(13)2-4-15(14)16(18)6-7-17(18)20/h3,5,10,14-17,19-20H,2,4,6-9H2,1H3/t14-,15-,16+,17-,18+/m1/s1 |
| InChIKey | VOXZDWNPVJITMN-SFFUCWETSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Roles: | estrogen A hormone that stimulates or controls the development and maintenance of female sex characteristics in mammals by binding to oestrogen receptors. The oestrogens are named for their importance in the oestrous cycle. The oestrogens that occur naturally in the body, notably estrone, estradiol, estriol, and estetrol are steroids. Other compounds with oestrogenic activity are produced by plants (phytoestrogens) and fungi (mycoestrogens); synthetic compounds with oestrogenic activity are known as xenoestrogens. estrogen A hormone that stimulates or controls the development and maintenance of female sex characteristics in mammals by binding to oestrogen receptors. The oestrogens are named for their importance in the oestrous cycle. The oestrogens that occur naturally in the body, notably estrone, estradiol, estriol, and estetrol are steroids. Other compounds with oestrogenic activity are produced by plants (phytoestrogens) and fungi (mycoestrogens); synthetic compounds with oestrogenic activity are known as xenoestrogens. human metabolite Any mammalian metabolite produced during a metabolic reaction in humans (Homo sapiens). |
| Application: | geroprotector Any compound that supports healthy aging, slows the biological aging process, or extends lifespan. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 17α-estradiol (CHEBI:17160) has role estrogen (CHEBI:50114) |
| 17α-estradiol (CHEBI:17160) has role geroprotector (CHEBI:176497) |
| 17α-estradiol (CHEBI:17160) is a 17α-hydroxy steroid (CHEBI:35342) |
| 17α-estradiol (CHEBI:17160) is a 3-hydroxy steroid (CHEBI:36834) |
| 17α-estradiol (CHEBI:17160) is a estradiol (CHEBI:23965) |
| Incoming Relation(s) |
| 17α-(N-acetyl-D-glucosaminyl)estradiol 3-glucosiduronic acid (CHEBI:16129) has functional parent 17α-estradiol (CHEBI:17160) |
| 17α-(N-acetyl-α-D-glucosaminyl)estradiol 3-glucuronoside (CHEBI:73201) has functional parent 17α-estradiol (CHEBI:17160) |
| 17α-estradiol 17-O-(β-D-glucuronide) (CHEBI:137490) has functional parent 17α-estradiol (CHEBI:17160) |
| 17α-estradiol 3-glucosiduronic acid (CHEBI:15822) has functional parent 17α-estradiol (CHEBI:17160) |
| IUPAC Name |
|---|
| estra-1,3,5(10)-triene-3,17α-diol |
| INNs | Source |
|---|---|
| alfatradiol | WHO MedNet |
| alfatradiol | WHO MedNet |
| alfatradiol | WHO MedNet |
| alfatradiolum | WHO MedNet |
| Synonyms | Source |
|---|---|
| 1,3,5-estratriene-3,17α-diol | ChEBI |
| 13β-methyl-1,3,5(10)-gonatriene-3,17α-diol | HMDB |
| 17alpha-Estradiol | KEGG COMPOUND |
| 17-epiestradiol | HMDB |
| (17α)-estra-1,3,5(10)-triene-3,17-diol | ChEBI |
| 17α-oestradiol | ChEBI |
| UniProt Name | Source |
|---|---|
| 17α-estradiol | UniProt |
| Manual Xrefs | Databases |
|---|---|
| 17%CE%B1-Estradiol | Wikipedia |
| 61840 | ChemSpider |
| C02537 | KEGG COMPOUND |
| C02537 | KEGG COMPOUND |
| CPD-351 | MetaCyc |
| D07121 | KEGG DRUG |
| FDB011524 | FooDB |
| HMDB0000429 | HMDB |
| LMST02010029 | LIPID MAPS |
| LSM-36371 | LINCS |
| Citations |
|---|