EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C30H37NO4 |
| Net Charge | 0 |
| Average Mass | 475.629 |
| Monoisotopic Mass | 475.27226 |
| SMILES | [H][C@@]12CC[C@](OC(C)=O)(C(C)=O)[C@@]1(C)C[C@H](c1ccc(N(C)C)cc1)C1=C3CCC(=O)C=C3CC[C@]12[H] |
| InChI | InChI=1S/C30H37NO4/c1-18(32)30(35-19(2)33)15-14-27-25-12-8-21-16-23(34)11-13-24(21)28(25)26(17-29(27,30)3)20-6-9-22(10-7-20)31(4)5/h6-7,9-10,16,25-27H,8,11-15,17H2,1-5H3/t25-,26+,27-,29-,30-/m0/s1 |
| InChIKey | OOLLAFOLCSJHRE-ZHAKMVSLSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Role: | progestin A synthetic progestogen. |
| Applications: | progesterone receptor modulator A hormone receptor modulator that acts as a complete or partial agonist or as an antagonist at the progesterone receptor. contraceptive drug A chemical substance that prevents or reduces the probability of conception. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| ulipristal acetate (CHEBI:71025) has functional parent estradiol (CHEBI:23965) |
| ulipristal acetate (CHEBI:71025) has role contraceptive drug (CHEBI:49323) |
| ulipristal acetate (CHEBI:71025) has role progesterone receptor modulator (CHEBI:71027) |
| ulipristal acetate (CHEBI:71025) has role progestin (CHEBI:59826) |
| ulipristal acetate (CHEBI:71025) is a 20-oxo steroid (CHEBI:36885) |
| ulipristal acetate (CHEBI:71025) is a 3-oxo-Δ4 steroid (CHEBI:47909) |
| ulipristal acetate (CHEBI:71025) is a acetate ester (CHEBI:47622) |
| ulipristal acetate (CHEBI:71025) is a steroid ester (CHEBI:47880) |
| ulipristal acetate (CHEBI:71025) is a tertiary amino compound (CHEBI:50996) |
| IUPAC Name |
|---|
| 17β-acetyl-11β-[4-(dimethylamino)phenyl]-3-oxoestra-4,9-dien-17α-yl acetate |
| Synonyms | Source |
|---|---|
| 17-Acetoxy-11-(4-N,N-dimethylaminophenyl)pregna-4,9-diene-3,20-dione | ChemIDplus |
| CDB 2914 | ChemIDplus |
| (11β,17α)-17-acetyl-11-[4-(dimethylamino)phenyl]-3-oxoestra-4,9-dien-17-yl acetate | IUPAC |
| Brand Name | Source |
|---|---|
| Ella | KEGG DRUG |
| Manual Xrefs | Databases |
|---|---|
| D09687 | KEGG DRUG |
| WO2007144674 | Patent |
| WO2004078709 | Patent |
| US4954490 | Patent |
| WO2008129396 | Patent |
| US2008199511 | Patent |
| US2007213306 | Patent |
| Ulipristal_acetate | Wikipedia |
| 4166 | DrugCentral |
| Registry Numbers | Sources |
|---|---|
| Reaxys:6946364 | Reaxys |
| CAS:126784-99-4 | KEGG DRUG |
| CAS:126784-99-4 | ChemIDplus |
| Citations |
|---|