EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H24O2 |
| Net Charge | 0 |
| Average Mass | 296.410 |
| Monoisotopic Mass | 296.17763 |
| SMILES | [H][C@@]12CC[C@@](O)(C#C)[C@@]1(C)CC[C@]1([H])c3ccc(O)cc3CC[C@@]21[H] |
| InChI | InChI=1S/C20H24O2/c1-3-20(22)11-9-18-17-6-4-13-12-14(21)5-7-15(13)16(17)8-10-19(18,20)2/h1,5,7,12,16-18,21-22H,4,6,8-11H2,2H3/t16-,17-,18+,19+,20+/m1/s1 |
| InChIKey | BFPYWIDHMRZLRN-SLHNCBLASA-N |
| Roles Classification |
|---|
| Biological Role: | xenoestrogen A synthetic or semi-synthetic compound that has oestrogenic activity. |
| Application: | xenoestrogen A synthetic or semi-synthetic compound that has oestrogenic activity. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 17α-ethynylestradiol (CHEBI:4903) has functional parent 17β-estradiol (CHEBI:16469) |
| 17α-ethynylestradiol (CHEBI:4903) has functional parent estradiol (CHEBI:23965) |
| 17α-ethynylestradiol (CHEBI:4903) has role xenoestrogen (CHEBI:76988) |
| 17α-ethynylestradiol (CHEBI:4903) is a 17-hydroxy steroid (CHEBI:36838) |
| 17α-ethynylestradiol (CHEBI:4903) is a 3-hydroxy steroid (CHEBI:36834) |
| 17α-ethynylestradiol (CHEBI:4903) is a terminal acetylenic compound (CHEBI:73477) |
| Incoming Relation(s) |
| 17α-ethynylestradiol 3-sulfate (CHEBI:136600) has functional parent 17α-ethynylestradiol (CHEBI:4903) |
| IUPAC Name |
|---|
| 17α-ethynylestra-1,3,5(10)-triene-3,17β-diol |
| Synonyms | Source |
|---|---|
| 17alpha-Ethinyl estradiol | KEGG COMPOUND |
| 17-ethinyl-3,17-estradiol | ChemIDplus |
| 17-ethinyl-3,17-oestradiol | ChemIDplus |
| 17-ethinylestradiol | ChemIDplus |
| Ethinyl estradiol | KEGG COMPOUND |
| Ethinylestradiol | KEGG COMPOUND |
| UniProt Name | Source |
|---|---|
| 17α-ethynylestradiol | UniProt |
| Manual Xrefs | Databases |
|---|---|
| 1082 | DrugCentral |
| 1887 | VSDB |
| C07534 | KEGG COMPOUND |
| D00554 | KEGG DRUG |
| DB00977 | DrugBank |
| HMDB0001926 | HMDB |
| LMST02010036 | LIPID MAPS |
| LSM-5593 | LINCS |
| Registry Numbers | Sources |
|---|---|
| Reaxys:2419975 | Reaxys |
| CAS:57-63-6 | KEGG COMPOUND |
| CAS:57-63-6 | ChemIDplus |
| Citations |
|---|