EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H24O2 |
| Net Charge | 0 |
| Average Mass | 296.410 |
| Monoisotopic Mass | 296.17763 |
| SMILES | [H][C@@]12CC[C@@](O)(C#C)[C@@]1(C)CC[C@]1([H])c3ccc(O)cc3CC[C@@]21[H] |
| InChI | InChI=1S/C20H24O2/c1-3-20(22)11-9-18-17-6-4-13-12-14(21)5-7-15(13)16(17)8-10-19(18,20)2/h1,5,7,12,16-18,21-22H,4,6,8-11H2,2H3/t16-,17-,18+,19+,20+/m1/s1 |
| InChIKey | BFPYWIDHMRZLRN-SLHNCBLASA-N |
| Roles Classification |
|---|
| Biological Roles: | anti-HIV agent An antiviral agent that destroys or inhibits the replication of the human immunodeficiency virus. antiviral agent A substance that destroys or inhibits replication of viruses. xenoestrogen A synthetic or semi-synthetic compound that has oestrogenic activity. anti-HBV agent An antiviral agent that destroys or inhibits the replication of the hepatitis B virus. anti-obesity agent Any substance which is used to reduce or control weight. |
| Applications: | xenoestrogen A synthetic or semi-synthetic compound that has oestrogenic activity. hypoglycemic agent A drug which lowers the blood glucose level. bone density conservation agent An agent that inhibits bone resorption and/or favor bone mineralization and bone regeneration. Used to heal bone fractures and to treat bone diseases such as osteopenia and osteoporosis. antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. antidepressant Antidepressants are mood-stimulating drugs used primarily in the treatment of affective disorders and related conditions. appetite enhancer A drug which increases appetite. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 17α-ethynylestradiol (CHEBI:4903) has functional parent 17β-estradiol (CHEBI:16469) |
| 17α-ethynylestradiol (CHEBI:4903) has functional parent estradiol (CHEBI:23965) |
| 17α-ethynylestradiol (CHEBI:4903) has role anti-HBV agent (CHEBI:64951) |
| 17α-ethynylestradiol (CHEBI:4903) has role anti-HIV agent (CHEBI:64946) |
| 17α-ethynylestradiol (CHEBI:4903) has role anti-obesity agent (CHEBI:74518) |
| 17α-ethynylestradiol (CHEBI:4903) has role antidepressant (CHEBI:35469) |
| 17α-ethynylestradiol (CHEBI:4903) has role antineoplastic agent (CHEBI:35610) |
| 17α-ethynylestradiol (CHEBI:4903) has role antiviral agent (CHEBI:22587) |
| 17α-ethynylestradiol (CHEBI:4903) has role appetite enhancer (CHEBI:50779) |
| 17α-ethynylestradiol (CHEBI:4903) has role bone density conservation agent (CHEBI:50646) |
| 17α-ethynylestradiol (CHEBI:4903) has role hypoglycemic agent (CHEBI:35526) |
| 17α-ethynylestradiol (CHEBI:4903) has role xenoestrogen (CHEBI:76988) |
| 17α-ethynylestradiol (CHEBI:4903) is a 17-hydroxy steroid (CHEBI:36838) |
| 17α-ethynylestradiol (CHEBI:4903) is a 3-hydroxy steroid (CHEBI:36834) |
| 17α-ethynylestradiol (CHEBI:4903) is a terminal acetylenic compound (CHEBI:73477) |
| Incoming Relation(s) |
| 17α-ethynylestradiol 3-sulfate (CHEBI:136600) has functional parent 17α-ethynylestradiol (CHEBI:4903) |
| IUPAC Name |
|---|
| 17α-ethynylestra-1,3,5(10)-triene-3,17β-diol |
| INN | Source |
|---|---|
| etinilestradiol | WHO MedNet |
| Synonyms | Source |
|---|---|
| 17alpha-ethinylestradiol | ChEMBL |
| 17alpha-Ethinyl estradiol | KEGG COMPOUND |
| 17-ethinyl-3,17-estradiol | ChemIDplus |
| 17-ethinyl-3,17-oestradiol | ChemIDplus |
| 17-ethinylestradiol | ChemIDplus |
| Enovid | ChEMBL |
| Brand Names | Source |
|---|---|
| Ethinyl estradiol component of alesse | ChEMBL |
| Ethinyl estradiol component of altavera | ChEMBL |
| Ethinyl estradiol component of annovera | ChEMBL |
| Ethinyl estradiol component of aranelle | ChEMBL |
| Ethinyl estradiol component of aviane | ChEMBL |
| Ethinyl estradiol component of balcoltra | ChEMBL |
| UniProt Name | Source |
|---|---|
| 17α-ethynylestradiol | UniProt |
| Manual Xrefs | Databases |
|---|---|
| 1082 | DrugCentral |
| 1887 | VSDB |
| C07534 | KEGG COMPOUND |
| D00554 | KEGG DRUG |
| DB00977 | DrugBank |
| HMDB0001926 | HMDB |
| LMST02010036 | LIPID MAPS |
| LSM-5593 | LINCS |
| Registry Numbers | Sources |
|---|---|
| Reaxys:2419975 | Reaxys |
| CAS:57-63-6 | KEGG COMPOUND |
| CAS:57-63-6 | ChemIDplus |
| Citations |
|---|