EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C15H11O7 |
| Net Charge | +1 |
| Average Mass | 303.246 |
| Monoisotopic Mass | 303.04993 |
| SMILES | Oc1cc(O)c2cc(O)c(-c3cc(O)c(O)c(O)c3)[o+]c2c1 |
| InChI | InChI=1S/C15H10O7/c16-7-3-9(17)8-5-12(20)15(22-13(8)4-7)6-1-10(18)14(21)11(19)2-6/h1-5H,(H5-,16,17,18,19,20,21)/p+1 |
| InChIKey | JKHRCGUTYDNCLE-UHFFFAOYSA-O |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Roles: | biological pigment An endogenous molecular entity that results in a colour of an organism as the consequence of the selective absorption of light. plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| delphinidin (CHEBI:28436) has role antineoplastic agent (CHEBI:35610) |
| delphinidin (CHEBI:28436) has role biological pigment (CHEBI:26130) |
| delphinidin (CHEBI:28436) has role plant metabolite (CHEBI:76924) |
| delphinidin (CHEBI:28436) is a 5-hydroxyanthocyanidin (CHEBI:140277) |
| delphinidin (CHEBI:28436) is conjugate acid of delphinidin(1−) (CHEBI:144775) |
| Incoming Relation(s) |
| delphinidin 3-O-(6-O-(E)-4-coumaroyl-β-D-glucoside) (CHEBI:75677) has functional parent delphinidin (CHEBI:28436) |
| delphinidin 3-O-(6-O-(Z)-4-coumaroyl-β-D-glucoside) (CHEBI:75675) has functional parent delphinidin (CHEBI:28436) |
| delphinidin 3-O-(6-O-acetyl-β-D-glucoside) (CHEBI:75678) has functional parent delphinidin (CHEBI:28436) |
| delphinidin 3-O-(6''-O-malonyl)-β-D-glucoside (CHEBI:55334) has functional parent delphinidin (CHEBI:28436) |
| delphinidin 3-O-(6''-O-malonyl)-β-D-glucoside-3'-O-β-D-glucoside (CHEBI:55336) has functional parent delphinidin (CHEBI:28436) |
| delphinidin 3-O-rutinoside-7-O-β-D-glucoside (CHEBI:145693) has functional parent delphinidin (CHEBI:28436) |
| delphinidin 3-O-β-D-glucoside (CHEBI:31463) has functional parent delphinidin (CHEBI:28436) |
| delphinidin 3-O-β-D-glucoside-5-O-β-D-glucoside (CHEBI:55455) has functional parent delphinidin (CHEBI:28436) |
| delphinidin 3-O-β-D-sambubioside (CHEBI:74810) has functional parent delphinidin (CHEBI:28436) |
| delphinidin 3,3',5-tri-O-glucoside (CHEBI:55456) has functional parent delphinidin (CHEBI:28436) |
| malvidin (CHEBI:6674) has functional parent delphinidin (CHEBI:28436) |
| ternatin C5 (CHEBI:55335) has functional parent delphinidin (CHEBI:28436) |
| delphinidin chloride (CHEBI:38701) has part delphinidin (CHEBI:28436) |
| delphinidin(1−) (CHEBI:144775) is conjugate base of delphinidin (CHEBI:28436) |
| IUPAC Name |
|---|
| 3,5,7-trihydroxy-2-(3,4,5-trihydroxyphenyl)chromenium |
| Synonym | Source |
|---|---|
| 3,3',4',5,5',7-Hexahydroxyflavylium | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| C00020091 | KNApSAcK |
| C05908 | KEGG COMPOUND |
| Delphinidin | Wikipedia |
| LMPK12010001 | LIPID MAPS |
| Registry Numbers | Sources |
|---|---|
| Reaxys:1691007 | Reaxys |
| CAS:13270-61-6 | ChemIDplus |
| Citations |
|---|