EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C21H21O12 |
| Net Charge | +1 |
| Average Mass | 465.387 |
| Monoisotopic Mass | 465.10275 |
| SMILES | OC[C@H]1O[C@@H](Oc2cc3c(O)cc(O)cc3[o+]c2-c2cc(O)c(O)c(O)c2)[C@H](O)[C@@H](O)[C@@H]1O |
| InChI | InChI=1S/C21H20O12/c22-6-15-17(28)18(29)19(30)21(33-15)32-14-5-9-10(24)3-8(23)4-13(9)31-20(14)7-1-11(25)16(27)12(26)2-7/h1-5,15,17-19,21-22,28-30H,6H2,(H4-,23,24,25,26,27)/p+1/t15-,17-,18+,19-,21-/m1/s1 |
| InChIKey | XENHPQQLDPAYIJ-PEVLUNPASA-O |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| delphinidin 3-O-β-D-glucoside (CHEBI:31463) has functional parent delphinidin (CHEBI:28436) |
| delphinidin 3-O-β-D-glucoside (CHEBI:31463) has role plant metabolite (CHEBI:76924) |
| delphinidin 3-O-β-D-glucoside (CHEBI:31463) is a anthocyanin cation (CHEBI:35218) |
| delphinidin 3-O-β-D-glucoside (CHEBI:31463) is a β-D-glucoside (CHEBI:22798) |
| delphinidin 3-O-β-D-glucoside (CHEBI:31463) is conjugate acid of delphinidin 3-O-β-D-glucoside betaine (CHEBI:144776) |
| Incoming Relation(s) |
| delphinidin 3-O-β-D-glucoside betaine (CHEBI:144776) is conjugate base of delphinidin 3-O-β-D-glucoside (CHEBI:31463) |
| IUPAC Name |
|---|
| 5,7-dihydroxy-2-(3,4,5-trihydroxyphenyl)chromenium-3-yl β-D-glucopyranoside |
| Synonyms | Source |
|---|---|
| delfinidin 3-O-β-D-glucoside | ChEBI |
| Delphinidin 3-glucoside | KEGG COMPOUND |
| Delphinidin 3-O-beta-D-glucoside | KEGG COMPOUND |
| Delphinidin 3-O-glucoside | KEGG COMPOUND |
| Manual Xrefs | Databases |
|---|---|
| C00006698 | KNApSAcK |
| C12138 | KEGG COMPOUND |
| Delphinidin-3-O-glucoside | Wikipedia |
| HMDB0037997 | HMDB |
| LMPK12010278 | LIPID MAPS |
| Registry Numbers | Sources |
|---|---|
| Reaxys:1695888 | Reaxys |
| CAS:50986-17-9 | KEGG COMPOUND |
| Citations |
|---|