EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C26H29O16 |
| Net Charge | +1 |
| Average Mass | 597.502 |
| Monoisotopic Mass | 597.14501 |
| SMILES | OC[C@H]1O[C@@H](Oc2cc3c(O)cc(O)cc3[o+]c2-c2cc(O)c(O)c(O)c2)[C@H](O[C@@H]2OC[C@@H](O)[C@H](O)[C@H]2O)[C@@H](O)[C@@H]1O |
| InChI | InChI=1S/C26H28O16/c27-6-17-20(35)21(36)24(42-25-22(37)19(34)14(32)7-38-25)26(41-17)40-16-5-10-11(29)3-9(28)4-15(10)39-23(16)8-1-12(30)18(33)13(31)2-8/h1-5,14,17,19-22,24-27,32,34-37H,6-7H2,(H4-,28,29,30,31,33)/p+1/t14-,17-,19+,20-,21+,22-,24-,25+,26-/m1/s1 |
| InChIKey | TWYYVOVDSNRIJM-AFAGGVQESA-O |
| Roles Classification |
|---|
| Biological Roles: | apoptosis inducer Any substance that induces the process of apoptosis (programmed cell death) in multi-celled organisms. metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| delphinidin 3-O-β-D-sambubioside (CHEBI:74810) has functional parent delphinidin (CHEBI:28436) |
| delphinidin 3-O-β-D-sambubioside (CHEBI:74810) has role apoptosis inducer (CHEBI:68495) |
| delphinidin 3-O-β-D-sambubioside (CHEBI:74810) has role metabolite (CHEBI:25212) |
| delphinidin 3-O-β-D-sambubioside (CHEBI:74810) is a anthocyanidin 3-O-β-D-sambubioside (CHEBI:71506) |
| IUPAC Name |
|---|
| 5,7-dihydroxy-2-(3,4,5-trihydroxyphenyl)chromenium-3-yl β-D-xylopyranosyl-(1→2)-β-D-glucopyranoside |
| Synonym | Source |
|---|---|
| Delphinidin 3-sambubioside | LIPID MAPS |
| Manual Xrefs | Databases |
|---|---|
| C20491 | KEGG COMPOUND |
| HMDB0038003 | HMDB |
| LMPK12010279 | LIPID MAPS |
| Registry Numbers | Sources |
|---|---|
| Reaxys:7327703 | Reaxys |
| CAS:53158-73-9 | HMDB |
| Citations |
|---|