EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:144775 - delphinidin(1−)
| Formula | C15H9O7 |
| Net Charge | -1 |
| Average Mass | 301.230 |
| Monoisotopic Mass | 301.03538 |
| SMILES | [O-]c1cc2c([O-])cc(O)cc2[o+]c1-c1cc(O)c(O)c(O)c1 |
| InChI | InChI=1S/C15H10O7/c16-7-3-9(17)8-5-12(20)15(22-13(8)4-7)6-1-10(18)14(21)11(19)2-6/h1-5H,(H5-,16,17,18,19,20,21)/p-1 |
| InChIKey | JKHRCGUTYDNCLE-UHFFFAOYSA-M |
| Roles Classification |
|---|
| Biological Roles: | biological pigment An endogenous molecular entity that results in a colour of an organism as the consequence of the selective absorption of light. plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| delphinidin(1−) (CHEBI:144775) has role antineoplastic agent (CHEBI:35610) |
| delphinidin(1−) (CHEBI:144775) has role biological pigment (CHEBI:26130) |
| delphinidin(1−) (CHEBI:144775) has role plant metabolite (CHEBI:76924) |
| delphinidin(1−) (CHEBI:144775) is a anthocyanidin betaine (CHEBI:143576) |
| delphinidin(1−) (CHEBI:144775) is a organic anion (CHEBI:25696) |
| delphinidin(1−) (CHEBI:144775) is conjugate base of delphinidin (CHEBI:28436) |
| Incoming Relation(s) |
| delphinidin 3-O-β-D-galactoside(1−) (CHEBI:193097) has functional parent delphinidin(1−) (CHEBI:144775) |
| delphinidin (CHEBI:28436) is conjugate acid of delphinidin(1−) (CHEBI:144775) |
| IUPAC Name |
|---|
| 7-hydroxy-2-(3,4,5-trihydroxyphenyl)chromenium-3,5-bis(olate) |
| Synonym | Source |
|---|---|
| 7-hydroxy-2-(3,4,5-trihydroxyphenyl)-1-benzopyran-1-ium-3,5-bis(olate) | IUPAC |
| UniProt Name | Source |
|---|---|
| delphinidin | UniProt |
| Manual Xrefs | Databases |
|---|---|
| CPD-7090 | MetaCyc |