EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
We are looking for a new Chemistry curator to join the ChEBI team. Find out more about it here.
CHEBI:15356 - cysteine
| Formula | C3H7NO2S |
| Net Charge | 0 |
| Average Mass | 121.161 |
| Monoisotopic Mass | 121.01975 |
| SMILES | NC(CS)C(=O)O |
| InChI | InChI=1S/C3H7NO2S/c4-2(1-7)3(5)6/h2,7H,1,4H2,(H,5,6) |
| InChIKey | XUJNEKJLAYXESH-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Arabidopsis thaliana (ncbitaxon:3702) | - | PubMed (24285094) | |
| Chlamydomonas reinhardtii (ncbitaxon:3055) | - | PubMed (25515814) | |
| Daphnia magna (ncbitaxon:35525) | - | PubMed (20117838) | |
| Homo sapiens (ncbitaxon:9606) | - | PubMed (21886157) | |
| Mus musculus (ncbitaxon:10090) | - | PubMed (25181601) |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | fundamental metabolite Any metabolite produced by all living cells. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| cysteine (CHEBI:15356) has part sulfanylmethyl group (CHEBI:50326) |
| cysteine (CHEBI:15356) has role fundamental metabolite (CHEBI:78675) |
| cysteine (CHEBI:15356) is a polar amino acid (CHEBI:26167) |
| cysteine (CHEBI:15356) is a sulfur-containing amino acid (CHEBI:26834) |
| cysteine (CHEBI:15356) is a α-amino acid (CHEBI:33704) |
| cysteine (CHEBI:15356) is conjugate acid of cysteinate(1−) (CHEBI:32456) |
| cysteine (CHEBI:15356) is conjugate base of cysteinium (CHEBI:32458) |
| cysteine (CHEBI:15356) is tautomer of cysteine zwitterion (CHEBI:35237) |
| Incoming Relation(s) |
| Se-L-selenocysteine-S-L-cysteine residue (CHEBI:142235) has functional parent cysteine (CHEBI:15356) |
| cysteine derivative (CHEBI:23509) has functional parent cysteine (CHEBI:15356) |
| cysteinyl radical (CHEBI:32740) has functional parent cysteine (CHEBI:15356) |
| γGluCys(IAN)Glu (CHEBI:64978) has functional parent cysteine (CHEBI:15356) |
| D-cysteine (CHEBI:16375) is a cysteine (CHEBI:15356) |
| L-cysteine (CHEBI:17561) is a cysteine (CHEBI:15356) |
| cysteinium (CHEBI:32458) is conjugate acid of cysteine (CHEBI:15356) |
| cysteinate(1−) (CHEBI:32456) is conjugate base of cysteine (CHEBI:15356) |
| cystein-S-yl group (CHEBI:32795) is substituent group from cysteine (CHEBI:15356) |
| cysteine residue (CHEBI:32460) is substituent group from cysteine (CHEBI:15356) |
| cysteino group (CHEBI:32459) is substituent group from cysteine (CHEBI:15356) |
| cysteinyl group (CHEBI:23511) is substituent group from cysteine (CHEBI:15356) |
| cysteine zwitterion (CHEBI:35237) is tautomer of cysteine (CHEBI:15356) |
| IUPAC Name |
|---|
| cysteine |
| Synonyms | Source |
|---|---|
| 2-amino-3-mercaptopropanoic acid | JCBN |
| 2-Amino-3-mercaptopropionic acid | KEGG COMPOUND |
| 2-amino-3-sulfanylpropanoic acid | IUPAC |
| C | ChEBI |
| cisteína | ChEBI |
| Cys | ChEBI |
| Citations |
|---|