EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C7H7NO5 |
| Net Charge | 0 |
| Average Mass | 185.135 |
| Monoisotopic Mass | 185.03242 |
| SMILES | [H]C(=O)C([H])=C([H])C(C(=O)O)=C(N)C(=O)O |
| InChI | InChI=1S/C7H7NO5/c8-5(7(12)13)4(6(10)11)2-1-3-9/h1-3H,8H2,(H,10,11)(H,12,13) |
| InChIKey | KACPVQQHDVBVFC-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | human metabolite Any mammalian metabolite produced during a metabolic reaction in humans (Homo sapiens). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 2-amino-3-(3-oxoprop-1-enyl)but-2-enedioic acid (CHEBI:19448) has functional parent butenedioic acid (CHEBI:22958) |
| 2-amino-3-(3-oxoprop-1-enyl)but-2-enedioic acid (CHEBI:19448) has role human metabolite (CHEBI:77746) |
| 2-amino-3-(3-oxoprop-1-enyl)but-2-enedioic acid (CHEBI:19448) is a amino dicarboxylic acid (CHEBI:36164) |
| 2-amino-3-(3-oxoprop-1-enyl)but-2-enedioic acid (CHEBI:19448) is a muconic semialdehyde (CHEBI:38436) |
| 2-amino-3-(3-oxoprop-1-enyl)but-2-enedioic acid (CHEBI:19448) is a non-proteinogenic α-amino acid (CHEBI:83925) |
| 2-amino-3-(3-oxoprop-1-enyl)but-2-enedioic acid (CHEBI:19448) is a oxo dicarboxylic acid (CHEBI:36145) |
| 2-amino-3-(3-oxoprop-1-enyl)but-2-enedioic acid (CHEBI:19448) is conjugate acid of 2-amino-3-(3-oxoprop-1-enyl)but-2-enedioate (CHEBI:29044) |
| 2-amino-3-(3-oxoprop-1-enyl)but-2-enedioic acid (CHEBI:19448) is conjugate acid of 2-ammonio-3-(3-oxoprop-1-enyl)but-2-enedioate(1−) (CHEBI:77803) |
| Incoming Relation(s) |
| cis,cis-2-amino-3-(3-oxoprop-1-enyl)but-2-enedioic acid (CHEBI:995) is a 2-amino-3-(3-oxoprop-1-enyl)but-2-enedioic acid (CHEBI:19448) |
| 2-amino-3-(3-oxoprop-1-enyl)but-2-enedioate (CHEBI:29044) is conjugate base of 2-amino-3-(3-oxoprop-1-enyl)but-2-enedioic acid (CHEBI:19448) |
| 2-ammonio-3-(3-oxoprop-1-enyl)but-2-enedioate(1−) (CHEBI:77803) is conjugate base of 2-amino-3-(3-oxoprop-1-enyl)but-2-enedioic acid (CHEBI:19448) |
| IUPAC Name |
|---|
| 2-amino-3-(3-oxoprop-1-en-1-yl)but-2-enedioic acid |
| Manual Xrefs | Databases |
|---|---|
| HMDB0001330 | HMDB |
| Registry Numbers | Sources |
|---|---|
| Beilstein:1950054 | Beilstein |