EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C8H7O4 |
| Net Charge | -1 |
| Average Mass | 167.140 |
| Monoisotopic Mass | 167.03498 |
| SMILES | O=C([O-])C(O)c1ccc(O)cc1 |
| InChI | InChI=1S/C8H8O4/c9-6-3-1-5(2-4-6)7(10)8(11)12/h1-4,7,9-10H,(H,11,12)/p-1 |
| InChIKey | YHXHKYRQLYQUIH-UHFFFAOYSA-M |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 4-hydroxymandelate (CHEBI:32804) has functional parent mandelate (CHEBI:25147) |
| 4-hydroxymandelate (CHEBI:32804) is a 2-hydroxy carboxylate (CHEBI:58896) |
| 4-hydroxymandelate (CHEBI:32804) is a phenols (CHEBI:33853) |
| 4-hydroxymandelate (CHEBI:32804) is conjugate base of 4-hydroxymandelic acid (CHEBI:16388) |
| Incoming Relation(s) |
| (R)-4-hydroxymandelate (CHEBI:27996) is a 4-hydroxymandelate (CHEBI:32804) |
| (S)-4-hydroxymandelate (CHEBI:17210) is a 4-hydroxymandelate (CHEBI:32804) |
| 4-hydroxymandelic acid (CHEBI:16388) is conjugate acid of 4-hydroxymandelate (CHEBI:32804) |
| IUPAC Name |
|---|
| hydroxy(4-hydroxyphenyl)acetate |
| UniProt Name | Source |
|---|---|
| 2-hydroxy-2-(4-hydroxyphenyl)acetate | UniProt |