EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C8H7O4 |
| Net Charge | -1 |
| Average Mass | 167.140 |
| Monoisotopic Mass | 167.03498 |
| SMILES | O=C([O-])[C@H](O)c1ccc(O)cc1 |
| InChI | InChI=1S/C8H8O4/c9-6-3-1-5(2-4-6)7(10)8(11)12/h1-4,7,9-10H,(H,11,12)/p-1/t7-/m1/s1 |
| InChIKey | YHXHKYRQLYQUIH-SSDOTTSWSA-M |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (R)-4-hydroxymandelate (CHEBI:27996) is a 4-hydroxymandelate (CHEBI:32804) |
| (R)-4-hydroxymandelate (CHEBI:27996) is conjugate base of (R)-4-hydroxymandelic acid (CHEBI:32803) |
| (R)-4-hydroxymandelate (CHEBI:27996) is enantiomer of (S)-4-hydroxymandelate (CHEBI:17210) |
| Incoming Relation(s) |
| (R)-4-hydroxymandelic acid (CHEBI:32803) is conjugate acid of (R)-4-hydroxymandelate (CHEBI:27996) |
| (S)-4-hydroxymandelate (CHEBI:17210) is enantiomer of (R)-4-hydroxymandelate (CHEBI:27996) |
| IUPAC Name |
|---|
| (2R)-hydroxy(4-hydroxyphenyl)acetate |
| Manual Xrefs | Databases |
|---|---|
| C05343 | KEGG COMPOUND |