EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C8H8O4 |
| Net Charge | 0 |
| Average Mass | 168.148 |
| Monoisotopic Mass | 168.04226 |
| SMILES | O=C(O)C(O)c1ccc(O)cc1 |
| InChI | InChI=1S/C8H8O4/c9-6-3-1-5(2-4-6)7(10)8(11)12/h1-4,7,9-10H,(H,11,12) |
| InChIKey | YHXHKYRQLYQUIH-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 4-hydroxymandelic acid (CHEBI:16388) has functional parent mandelic acid (CHEBI:35825) |
| 4-hydroxymandelic acid (CHEBI:16388) has role metabolite (CHEBI:25212) |
| 4-hydroxymandelic acid (CHEBI:16388) is a 2-hydroxy carboxylic acid (CHEBI:52618) |
| 4-hydroxymandelic acid (CHEBI:16388) is a phenols (CHEBI:33853) |
| 4-hydroxymandelic acid (CHEBI:16388) is conjugate acid of 4-hydroxymandelate (CHEBI:32804) |
| Incoming Relation(s) |
| (R)-4-hydroxymandelic acid (CHEBI:32803) is a 4-hydroxymandelic acid (CHEBI:16388) |
| (S)-4-hydroxymandelic acid (CHEBI:32802) is a 4-hydroxymandelic acid (CHEBI:16388) |
| 4-hydroxymandelate (CHEBI:32804) is conjugate base of 4-hydroxymandelic acid (CHEBI:16388) |
| IUPAC Name |
|---|
| hydroxy(4-hydroxyphenyl)acetic acid |
| Synonyms | Source |
|---|---|
| 4-hydroxymandelic acid | ChEBI |
| 4-hydroxymandelic acid | ChemIDplus |
| 4-hydroxyphenylglycolic acid | ChemIDplus |
| 4-Hydroxymandelic acid | KEGG COMPOUND |
| Manual Xrefs | Databases |
|---|---|
| C11527 | KEGG COMPOUND |
| HMDB0000822 | HMDB |
| Registry Numbers | Sources |
|---|---|
| Gmelin:486823 | Gmelin |
| Reaxys:2365374 | Reaxys |
| CAS:1198-84-1 | ChemIDplus |
| Citations |
|---|